Which Of The Following Is The Correctly Balanced Chemical Equation For The Reaction Of $Ca(OH)_2$ And $HNO_3$?A. $Ca(OH)_2 + HNO_3 \rightarrow Ca^{2+} + NO_3^{-}$B. $Ca(OH)_2 + 2HNO_3 \rightarrow 2H_2O + 2NO_3^{-}$C.

by ADMIN 217 views

Understanding the Chemical Reaction

The reaction between calcium hydroxide (Ca(OH)2Ca(OH)_2) and nitric acid (HNO3HNO_3) is a common example in chemistry that involves the neutralization of a base by an acid. This reaction is crucial in various industrial processes, including the production of fertilizers and the treatment of wastewater. To write a balanced chemical equation, we need to consider the reactants and products involved in the reaction.

The Reactants: Ca(OH)2Ca(OH)_2 and HNO3HNO_3

  • Calcium Hydroxide (Ca(OH)2Ca(OH)_2): This is a strong base that consists of calcium ions (Ca2+Ca^{2+}) and hydroxide ions (OHOH^{-}).
  • Nitric Acid (HNO3HNO_3): This is a strong acid that consists of hydrogen ions (H+H^+) and nitrate ions (NO3NO_3^{-}).

The Products: Ca2+Ca^{2+}, NO3NO_3^{-}, and H2OH_2O

  • Calcium Ions (Ca2+Ca^{2+}): These are the positively charged ions that result from the dissociation of calcium hydroxide.
  • Nitrate Ions (NO3NO_3^{-}): These are the negatively charged ions that result from the dissociation of nitric acid.
  • Water (H2OH_2O): This is the product of the neutralization reaction between the base and the acid.

Balancing the Chemical Equation

To balance the chemical equation, we need to ensure that the number of atoms of each element is the same on both the reactant and product sides. Let's examine the given options:

Option A: Ca(OH)2+HNO3Ca2++NO3Ca(OH)_2 + HNO_3 \rightarrow Ca^{2+} + NO_3^{-}

This option is not balanced because it does not account for the hydroxide ions (OHOH^{-}) that are present in the reactant calcium hydroxide. Additionally, it does not consider the hydrogen ions (H+H^+) that are present in the reactant nitric acid.

Option B: Ca(OH)2+2HNO32H2O+2NO3Ca(OH)_2 + 2HNO_3 \rightarrow 2H_2O + 2NO_3^{-}

This option is not balanced because it does not account for the calcium ions (Ca2+Ca^{2+}) that are present in the reactant calcium hydroxide. Additionally, it does not consider the hydrogen ions (H+H^+) that are present in the reactant nitric acid.

Option C: Ca(OH)2+2HNO3Ca(NO3)2+2H2OCa(OH)_2 + 2HNO_3 \rightarrow Ca(NO_3)_2 + 2H_2O

This option is balanced because it accounts for the calcium ions (Ca2+Ca^{2+}), hydroxide ions (OHOH^{-}), hydrogen ions (H+H^+), and nitrate ions (NO3NO_3^{-}) that are present in the reactants. The products include calcium nitrate (Ca(NO3)2Ca(NO_3)_2) and water (H2OH_2O).

Conclusion

In conclusion, the correctly balanced chemical equation for the reaction of Ca(OH)2Ca(OH)_2 and HNO3HNO_3 is:

Ca(OH)2+2HNO3Ca(NO3)2+2H2OCa(OH)_2 + 2HNO_3 \rightarrow Ca(NO_3)_2 + 2H_2O

This equation is balanced because it accounts for the number of atoms of each element on both the reactant and product sides. The reaction between calcium hydroxide and nitric acid is a common example in chemistry that involves the neutralization of a base by an acid. Understanding the balanced chemical equation is crucial in various industrial processes, including the production of fertilizers and the treatment of wastewater.

Key Takeaways

  • The reaction between calcium hydroxide (Ca(OH)2Ca(OH)_2) and nitric acid (HNO3HNO_3) is a common example in chemistry that involves the neutralization of a base by an acid.
  • To write a balanced chemical equation, we need to consider the reactants and products involved in the reaction.
  • The correctly balanced chemical equation for the reaction of Ca(OH)2Ca(OH)_2 and HNO3HNO_3 is: Ca(OH)2+2HNO3Ca(NO3)2+2H2OCa(OH)_2 + 2HNO_3 \rightarrow Ca(NO_3)_2 + 2H_2O
  • Understanding the balanced chemical equation is crucial in various industrial processes, including the production of fertilizers and the treatment of wastewater.

Frequently Asked Questions

  • What is the reaction between calcium hydroxide and nitric acid? The reaction between calcium hydroxide (Ca(OH)2Ca(OH)_2) and nitric acid (HNO3HNO_3) is a common example in chemistry that involves the neutralization of a base by an acid.
  • How do you balance a chemical equation? To balance a chemical equation, we need to ensure that the number of atoms of each element is the same on both the reactant and product sides.
  • What is the correctly balanced chemical equation for the reaction of Ca(OH)2Ca(OH)_2 and HNO3HNO_3? The correctly balanced chemical equation for the reaction of Ca(OH)2Ca(OH)_2 and HNO3HNO_3 is: Ca(OH)2+2HNO3Ca(NO3)2+2H2OCa(OH)_2 + 2HNO_3 \rightarrow Ca(NO_3)_2 + 2H_2O

Q: What is the reaction between calcium hydroxide and nitric acid?

A: The reaction between calcium hydroxide (Ca(OH)2Ca(OH)_2) and nitric acid (HNO3HNO_3) is a common example in chemistry that involves the neutralization of a base by an acid. This reaction is crucial in various industrial processes, including the production of fertilizers and the treatment of wastewater.

Q: How do you balance a chemical equation?

A: To balance a chemical equation, we need to ensure that the number of atoms of each element is the same on both the reactant and product sides. This involves identifying the reactants and products, counting the number of atoms of each element, and adjusting the coefficients of the reactants and products to achieve a balanced equation.

Q: What is the correctly balanced chemical equation for the reaction of Ca(OH)2Ca(OH)_2 and HNO3HNO_3?

A: The correctly balanced chemical equation for the reaction of Ca(OH)2Ca(OH)_2 and HNO3HNO_3 is: Ca(OH)2+2HNO3Ca(NO3)2+2H2OCa(OH)_2 + 2HNO_3 \rightarrow Ca(NO_3)_2 + 2H_2O. This equation is balanced because it accounts for the number of atoms of each element on both the reactant and product sides.

Q: What are the products of the reaction between calcium hydroxide and nitric acid?

A: The products of the reaction between calcium hydroxide (Ca(OH)2Ca(OH)_2) and nitric acid (HNO3HNO_3) are calcium nitrate (Ca(NO3)2Ca(NO_3)_2) and water (H2OH_2O).

Q: Why is balancing a chemical equation important?

A: Balancing a chemical equation is important because it ensures that the number of atoms of each element is the same on both the reactant and product sides. This is crucial in understanding the stoichiometry of a reaction, which is the quantitative relationship between the reactants and products.

Q: How do you determine the coefficients of a balanced chemical equation?

A: To determine the coefficients of a balanced chemical equation, we need to count the number of atoms of each element on both the reactant and product sides. We then adjust the coefficients of the reactants and products to achieve a balanced equation.

Q: What is the difference between a balanced and unbalanced chemical equation?

A: A balanced chemical equation has the same number of atoms of each element on both the reactant and product sides, while an unbalanced chemical equation does not have the same number of atoms of each element on both sides.

Q: Why is it important to consider the stoichiometry of a reaction?

A: It is important to consider the stoichiometry of a reaction because it determines the quantitative relationship between the reactants and products. This is crucial in understanding the yield of a reaction and the amount of product that can be obtained.

Q: How do you write a balanced chemical equation for a reaction?

A: To write a balanced chemical equation for a reaction, we need to identify the reactants and products, count the number of atoms of each element, and adjust the coefficients of the reactants and products to achieve a balanced equation.

Q: What are some common mistakes to avoid when balancing a chemical equation?

A: Some common mistakes to avoid when balancing a chemical equation include:

  • Not counting the number of atoms of each element on both the reactant and product sides.
  • Not adjusting the coefficients of the reactants and products to achieve a balanced equation.
  • Not considering the stoichiometry of the reaction.

Q: How do you check if a chemical equation is balanced?

A: To check if a chemical equation is balanced, we need to count the number of atoms of each element on both the reactant and product sides. If the number of atoms of each element is the same on both sides, then the equation is balanced.

Q: What is the importance of balancing a chemical equation in chemistry?

A: Balancing a chemical equation is important in chemistry because it ensures that the number of atoms of each element is the same on both the reactant and product sides. This is crucial in understanding the stoichiometry of a reaction, which is the quantitative relationship between the reactants and products.