Which Of The Following Choices Represents A Balanced Chemical Equation?A. C A 3 ( P O 4 ) 2 + 6 S I O 2 → P 4 O 10 + 3 C A S I O 3 Ca_3(PO_4)_2 + 6SiO_2 \rightarrow P_4O_{10} + 3CaSiO_3 C A 3 ​ ( P O 4 ​ ) 2 ​ + 6 S I O 2 ​ → P 4 ​ O 10 ​ + 3 C A S I O 3 ​ B. 2 C A 3 ( P O 4 ) 2 + 6 S I O 2 → P 4 O 10 + 6 C A S I O 3 2Ca_3(PO_4)_2 + 6SiO_2 \rightarrow P_4O_{10} + 6CaSiO_3 2 C A 3 ​ ( P O 4 ​ ) 2 ​ + 6 S I O 2 ​ → P 4 ​ O 10 ​ + 6 C A S I O 3 ​ C. $2Ca_3(PO_4)_2 + 3SiO_2

by ADMIN 475 views

Chemical equations are a fundamental concept in chemistry, representing the transformation of one or more substances into another. A balanced chemical equation is a crucial aspect of this concept, as it ensures that the number of atoms of each element is the same on both the reactant and product sides. In this article, we will explore the concept of balanced chemical equations and examine three given choices to determine which one represents a balanced chemical equation.

What is a Balanced Chemical Equation?

A balanced chemical equation is a chemical equation in which the number of atoms of each element is the same on both the reactant and product sides. This means that the number of atoms of each element is conserved during the reaction. A balanced chemical equation is essential in chemistry as it helps to:

  • Predict the products of a reaction: By balancing the chemical equation, we can predict the products of a reaction and understand the stoichiometry of the reaction.
  • Calculate the amount of reactants and products: A balanced chemical equation allows us to calculate the amount of reactants and products required for a reaction.
  • Understand the energy changes: A balanced chemical equation helps us to understand the energy changes that occur during a reaction.

How to Balance a Chemical Equation

Balancing a chemical equation involves adding coefficients to the reactants and products to ensure that the number of atoms of each element is the same on both sides. The steps to balance a chemical equation are:

  1. Write the unbalanced equation: Write the chemical equation with the reactants and products.
  2. Count the atoms: Count the number of atoms of each element on both the reactant and product sides.
  3. Add coefficients: Add coefficients to the reactants and products to ensure that the number of atoms of each element is the same on both sides.
  4. Check the balance: Check the balance of the equation by counting the number of atoms of each element on both sides.

Analyzing the Given Choices

Let's analyze the three given choices to determine which one represents a balanced chemical equation.

Choice A: Ca3(PO4)2+6SiO2P4O10+3CaSiO3Ca_3(PO_4)_2 + 6SiO_2 \rightarrow P_4O_{10} + 3CaSiO_3

In this choice, the number of atoms of each element is not the same on both the reactant and product sides. The reactant side has 3 calcium atoms, 2 phosphorus atoms, 8 oxygen atoms, and 6 silicon atoms. The product side has 4 phosphorus atoms, 10 oxygen atoms, 3 calcium atoms, and 3 silicon atoms. Therefore, this choice does not represent a balanced chemical equation.

Choice B: 2Ca3(PO4)2+6SiO2P4O10+6CaSiO32Ca_3(PO_4)_2 + 6SiO_2 \rightarrow P_4O_{10} + 6CaSiO_3

In this choice, the number of atoms of each element is not the same on both the reactant and product sides. The reactant side has 6 calcium atoms, 4 phosphorus atoms, 16 oxygen atoms, and 6 silicon atoms. The product side has 4 phosphorus atoms, 10 oxygen atoms, 6 calcium atoms, and 6 silicon atoms. Therefore, this choice does not represent a balanced chemical equation.

Choice C: 2Ca3(PO4)2+3SiO2P4O10+6CaSiO32Ca_3(PO_4)_2 + 3SiO_2 \rightarrow P_4O_{10} + 6CaSiO_3

In this choice, the number of atoms of each element is the same on both the reactant and product sides. The reactant side has 6 calcium atoms, 4 phosphorus atoms, 16 oxygen atoms, and 3 silicon atoms. The product side has 4 phosphorus atoms, 10 oxygen atoms, 6 calcium atoms, and 6 silicon atoms. Therefore, this choice represents a balanced chemical equation.

Conclusion

In conclusion, a balanced chemical equation is a crucial concept in chemistry, representing the transformation of one or more substances into another. By balancing the chemical equation, we can predict the products of a reaction, calculate the amount of reactants and products, and understand the energy changes that occur during a reaction. In this article, we analyzed three given choices to determine which one represents a balanced chemical equation. Based on the analysis, choice C: 2Ca3(PO4)2+3SiO2P4O10+6CaSiO32Ca_3(PO_4)_2 + 3SiO_2 \rightarrow P_4O_{10} + 6CaSiO_3 represents a balanced chemical equation.

References

  • ChemGuide: A comprehensive guide to chemistry, including balanced chemical equations.
  • Chemistry LibreTexts: A free online textbook for chemistry, including balanced chemical equations.
  • Wikipedia: A free online encyclopedia, including articles on balanced chemical equations.

Further Reading

  • Balancing Chemical Equations: A tutorial on balancing chemical equations.
  • Chemical Equations: A tutorial on chemical equations, including balanced chemical equations.
  • Stoichiometry: A tutorial on stoichiometry, including balanced chemical equations.
    Balanced Chemical Equations: Q&A =====================================

In our previous article, we discussed the concept of balanced chemical equations and analyzed three given choices to determine which one represents a balanced chemical equation. In this article, we will answer some frequently asked questions about balanced chemical equations.

Q: What is the purpose of balancing a chemical equation?

A: The purpose of balancing a chemical equation is to ensure that the number of atoms of each element is the same on both the reactant and product sides. This is essential in chemistry as it helps to predict the products of a reaction, calculate the amount of reactants and products, and understand the energy changes that occur during a reaction.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, follow these steps:

  1. Write the unbalanced equation: Write the chemical equation with the reactants and products.
  2. Count the atoms: Count the number of atoms of each element on both the reactant and product sides.
  3. Add coefficients: Add coefficients to the reactants and products to ensure that the number of atoms of each element is the same on both sides.
  4. Check the balance: Check the balance of the equation by counting the number of atoms of each element on both sides.

Q: What are some common mistakes to avoid when balancing a chemical equation?

A: Some common mistakes to avoid when balancing a chemical equation include:

  • Not counting the atoms correctly: Make sure to count the atoms of each element on both the reactant and product sides.
  • Not adding coefficients correctly: Make sure to add coefficients to the reactants and products to ensure that the number of atoms of each element is the same on both sides.
  • Not checking the balance: Make sure to check the balance of the equation by counting the number of atoms of each element on both sides.

Q: Can a chemical equation be balanced in more than one way?

A: Yes, a chemical equation can be balanced in more than one way. However, the balanced equation that is most commonly used is the one that has the fewest number of coefficients.

Q: How do I know if a chemical equation is balanced?

A: To determine if a chemical equation is balanced, follow these steps:

  1. Count the atoms: Count the number of atoms of each element on both the reactant and product sides.
  2. Check the balance: Check the balance of the equation by counting the number of atoms of each element on both sides.
  3. Verify the balance: Verify that the number of atoms of each element is the same on both the reactant and product sides.

Q: What is the significance of balancing a chemical equation?

A: Balancing a chemical equation is significant because it helps to:

  • Predict the products of a reaction: By balancing the chemical equation, we can predict the products of a reaction and understand the stoichiometry of the reaction.
  • Calculate the amount of reactants and products: A balanced chemical equation allows us to calculate the amount of reactants and products required for a reaction.
  • Understand the energy changes: A balanced chemical equation helps us to understand the energy changes that occur during a reaction.

Q: Can a chemical equation be unbalanced?

A: Yes, a chemical equation can be unbalanced. An unbalanced chemical equation is one in which the number of atoms of each element is not the same on both the reactant and product sides.

Q: How do I determine if a chemical equation is unbalanced?

A: To determine if a chemical equation is unbalanced, follow these steps:

  1. Count the atoms: Count the number of atoms of each element on both the reactant and product sides.
  2. Check the balance: Check the balance of the equation by counting the number of atoms of each element on both sides.
  3. Verify the balance: Verify that the number of atoms of each element is not the same on both the reactant and product sides.

Conclusion

In conclusion, balancing a chemical equation is a crucial concept in chemistry, representing the transformation of one or more substances into another. By balancing the chemical equation, we can predict the products of a reaction, calculate the amount of reactants and products, and understand the energy changes that occur during a reaction. In this article, we answered some frequently asked questions about balanced chemical equations.

References

  • ChemGuide: A comprehensive guide to chemistry, including balanced chemical equations.
  • Chemistry LibreTexts: A free online textbook for chemistry, including balanced chemical equations.
  • Wikipedia: A free online encyclopedia, including articles on balanced chemical equations.

Further Reading

  • Balancing Chemical Equations: A tutorial on balancing chemical equations.
  • Chemical Equations: A tutorial on chemical equations, including balanced chemical equations.
  • Stoichiometry: A tutorial on stoichiometry, including balanced chemical equations.