The Equation For The Complete Combustion Of Propane, $C_3H_8$, Is:$C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l$\]What Is The Maximum Mass Of Carbon Dioxide Produced When A Mixture Of 0.500 Mole Of Propane And 3.00 Moles Of

by ADMIN 230 views

Introduction

The combustion of propane is a fundamental chemical reaction that involves the complete oxidation of propane to produce carbon dioxide and water. The equation for this reaction is given as: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l). In this article, we will explore the maximum mass of carbon dioxide produced when a mixture of 0.500 mole of propane and 3.00 moles of oxygen is combusted.

Understanding the Chemical Equation

The chemical equation for the combustion of propane is a balanced equation, which means that the number of atoms of each element is the same on both the reactant and product sides. The equation can be broken down into two main parts: the reactants and the products.

  • Reactants: The reactants in this equation are propane (C3H8C_3H_8) and oxygen (O2O_2). The number of moles of propane is given as 0.500 mole, and the number of moles of oxygen is given as 3.00 moles.
  • Products: The products in this equation are carbon dioxide (CO2CO_2) and water (H2OH_2O). The number of moles of carbon dioxide produced is 3 times the number of moles of propane, which is 3 * 0.500 = 1.50 moles. The number of moles of water produced is 4 times the number of moles of propane, which is 4 * 0.500 = 2.00 moles.

Calculating the Maximum Mass of Carbon Dioxide Produced

To calculate the maximum mass of carbon dioxide produced, we need to use the molar mass of carbon dioxide. The molar mass of carbon dioxide is 44.01 g/mol. We can calculate the mass of carbon dioxide produced by multiplying the number of moles of carbon dioxide by its molar mass.

Step 1: Calculate the number of moles of carbon dioxide produced

The number of moles of carbon dioxide produced is 1.50 moles.

Step 2: Calculate the mass of carbon dioxide produced

The mass of carbon dioxide produced can be calculated by multiplying the number of moles of carbon dioxide by its molar mass.

mass_carbon_dioxide = number_moles_carbon_dioxide * molar_mass_carbon_dioxide mass_carbon_dioxide = 1.50 * 44.01 mass_carbon_dioxide = 66.015 g

Conclusion

In this article, we have explored the maximum mass of carbon dioxide produced when a mixture of 0.500 mole of propane and 3.00 moles of oxygen is combusted. We have used the chemical equation for the combustion of propane to calculate the number of moles of carbon dioxide produced and then calculated the mass of carbon dioxide produced by multiplying the number of moles of carbon dioxide by its molar mass. The maximum mass of carbon dioxide produced is 66.015 g.

References

  • Chemical Equation for Combustion of Propane: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
  • Molar Mass of Carbon Dioxide: 44.01 g/mol

Frequently Asked Questions

  • What is the chemical equation for the combustion of propane?
    • The chemical equation for the combustion of propane is: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
  • What is the molar mass of carbon dioxide?
    • The molar mass of carbon dioxide is 44.01 g/mol
  • How can I calculate the maximum mass of carbon dioxide produced?
    • To calculate the maximum mass of carbon dioxide produced, you need to multiply the number of moles of carbon dioxide by its molar mass.
      The Equation for Complete Combustion of Propane: Understanding the Maximum Mass of Carbon Dioxide Produced ====================================================================================

Q&A: Frequently Asked Questions

Q: What is the chemical equation for the combustion of propane? A: The chemical equation for the combustion of propane is: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)

Q: What is the molar mass of carbon dioxide? A: The molar mass of carbon dioxide is 44.01 g/mol

Q: How can I calculate the maximum mass of carbon dioxide produced? A: To calculate the maximum mass of carbon dioxide produced, you need to multiply the number of moles of carbon dioxide by its molar mass.

Q: What is the relationship between the number of moles of propane and the number of moles of carbon dioxide produced? A: The number of moles of carbon dioxide produced is 3 times the number of moles of propane.

Q: What is the relationship between the number of moles of oxygen and the number of moles of carbon dioxide produced? A: The number of moles of oxygen required to produce 1 mole of carbon dioxide is 5/3 moles.

Q: Can I use this equation to calculate the maximum mass of carbon dioxide produced from a mixture of propane and oxygen? A: Yes, you can use this equation to calculate the maximum mass of carbon dioxide produced from a mixture of propane and oxygen.

Q: What are the limitations of this equation? A: This equation assumes that the reaction is complete and that there are no side reactions. In reality, the reaction may not be complete, and there may be side reactions that produce different products.

Q: How can I apply this equation to real-world problems? A: You can apply this equation to real-world problems such as calculating the amount of carbon dioxide produced from the combustion of propane in a car engine or a power plant.

Q: What are some common mistakes to avoid when using this equation? A: Some common mistakes to avoid when using this equation include:

  • Not balancing the equation
  • Not using the correct molar masses
  • Not considering the limitations of the equation

Conclusion

In this article, we have provided a Q&A section to help answer some of the most frequently asked questions about the equation for the complete combustion of propane. We have covered topics such as the chemical equation, molar mass of carbon dioxide, and how to calculate the maximum mass of carbon dioxide produced. We have also discussed some common mistakes to avoid when using this equation.

References

  • Chemical Equation for Combustion of Propane: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
  • Molar Mass of Carbon Dioxide: 44.01 g/mol

Frequently Asked Questions

  • What is the chemical equation for the combustion of propane?
    • The chemical equation for the combustion of propane is: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
  • What is the molar mass of carbon dioxide?
    • The molar mass of carbon dioxide is 44.01 g/mol
  • How can I calculate the maximum mass of carbon dioxide produced?
    • To calculate the maximum mass of carbon dioxide produced, you need to multiply the number of moles of carbon dioxide by its molar mass.