If The Δ H ∘ \Delta H^{\circ} Δ H ∘ For The Following Reaction Is -1790 KJ, What Is The Δ H F ∘ \Delta H_f^{\circ} Δ H F ∘ ​ (in K J / M O L KJ/mol K J / M O L ) For C 3 H 6 O C_3H_6O C 3 ​ H 6 ​ O ?Reaction:$3 , C_3H_6O(l) + 4 , O_2(g) \rightarrow 3 , CO_2(g) + 3 , H_2O(l)

by ADMIN 275 views

Introduction

Thermochemical calculations are essential in understanding the energy changes that occur during chemical reactions. One of the key concepts in thermochemistry is the standard enthalpy of formation, denoted as ΔHf\Delta H_f^{\circ}. This value represents the change in enthalpy that occurs when one mole of a substance is formed from its constituent elements in their standard states. In this article, we will explore how to calculate the standard enthalpy of formation for a given compound using the standard enthalpy change of a reaction.

The Reaction and Given Information

The reaction given is:

3C3H6O(l)+4O2(g)3CO2(g)+3H2O(l)3 \, C_3H_6O(l) + 4 \, O_2(g) \rightarrow 3 \, CO_2(g) + 3 \, H_2O(l)

The standard enthalpy change for this reaction, denoted as ΔH\Delta H^{\circ}, is given as -1790 kJ. We are asked to find the standard enthalpy of formation for C3H6OC_3H_6O, denoted as ΔHf\Delta H_f^{\circ}.

Step 1: Write the Balanced Equation for the Formation of C3H6OC_3H_6O

To calculate the standard enthalpy of formation for C3H6OC_3H_6O, we need to write the balanced equation for the formation of this compound from its constituent elements. The balanced equation is:

C(s)+3H2(g)+32O2(g)C3H6O(l)C(s) + 3H_2(g) + \frac{3}{2}O_2(g) \rightarrow C_3H_6O(l)

Step 2: Calculate the Standard Enthalpy Change for the Formation of C3H6OC_3H_6O

To calculate the standard enthalpy change for the formation of C3H6OC_3H_6O, we need to calculate the standard enthalpy change for the reaction:

C(s)+3H2(g)+32O2(g)C3H6O(l)C(s) + 3H_2(g) + \frac{3}{2}O_2(g) \rightarrow C_3H_6O(l)

We can do this by using the standard enthalpy changes for the formation of the individual elements and compounds involved in the reaction. The standard enthalpy changes for the formation of the elements and compounds are:

  • ΔHf(C(s))=0\Delta H_f^{\circ}(C(s)) = 0 kJ/mol
  • ΔHf(H2(g))=0\Delta H_f^{\circ}(H_2(g)) = 0 kJ/mol
  • ΔHf(O2(g))=0\Delta H_f^{\circ}(O_2(g)) = 0 kJ/mol
  • ΔHf(C3H6O(l))=?\Delta H_f^{\circ}(C_3H_6O(l)) = ? kJ/mol (unknown)

The standard enthalpy change for the reaction is given by:

ΔH=ΔHf(products)ΔHf(reactants)\Delta H^{\circ} = \sum \Delta H_f^{\circ}(\text{products}) - \sum \Delta H_f^{\circ}(\text{reactants})

Substituting the values, we get:

ΔH=ΔHf(C3H6O(l))ΔHf(C(s))3ΔHf(H2(g))32ΔHf(O2(g))\Delta H^{\circ} = \Delta H_f^{\circ}(C_3H_6O(l)) - \Delta H_f^{\circ}(C(s)) - 3\Delta H_f^{\circ}(H_2(g)) - \frac{3}{2}\Delta H_f^{\circ}(O_2(g))

Simplifying, we get:

ΔH=ΔHf(C3H6O(l))\Delta H^{\circ} = \Delta H_f^{\circ}(C_3H_6O(l))

Step 3: Use the Given Information to Calculate the Standard Enthalpy of Formation for C3H6OC_3H_6O

We are given that the standard enthalpy change for the reaction:

3C3H6O(l)+4O2(g)3CO2(g)+3H2O(l)3 \, C_3H_6O(l) + 4 \, O_2(g) \rightarrow 3 \, CO_2(g) + 3 \, H_2O(l)

is -1790 kJ. We can use this information to calculate the standard enthalpy of formation for C3H6OC_3H_6O.

First, we need to write the balanced equation for the reaction:

3C3H6O(l)+4O2(g)3CO2(g)+3H2O(l)3 \, C_3H_6O(l) + 4 \, O_2(g) \rightarrow 3 \, CO_2(g) + 3 \, H_2O(l)

Next, we can calculate the standard enthalpy change for the reaction using the standard enthalpy changes for the formation of the individual elements and compounds involved in the reaction. The standard enthalpy changes for the formation of the elements and compounds are:

  • ΔHf(C3H6O(l))=?\Delta H_f^{\circ}(C_3H_6O(l)) = ? kJ/mol (unknown)
  • ΔHf(CO2(g))=393.5\Delta H_f^{\circ}(CO_2(g)) = -393.5 kJ/mol
  • ΔHf(H2O(l))=285.8\Delta H_f^{\circ}(H_2O(l)) = -285.8 kJ/mol
  • ΔHf(O2(g))=0\Delta H_f^{\circ}(O_2(g)) = 0 kJ/mol

The standard enthalpy change for the reaction is given by:

ΔH=ΔHf(products)ΔHf(reactants)\Delta H^{\circ} = \sum \Delta H_f^{\circ}(\text{products}) - \sum \Delta H_f^{\circ}(\text{reactants})

Substituting the values, we get:

1790=3ΔHf(CO2(g))+3ΔHf(H2O(l))3ΔHf(C3H6O(l))-1790 = 3\Delta H_f^{\circ}(CO_2(g)) + 3\Delta H_f^{\circ}(H_2O(l)) - 3\Delta H_f^{\circ}(C_3H_6O(l))

Simplifying, we get:

1790=3(393.5)+3(285.8)3ΔHf(C3H6O(l))-1790 = 3(-393.5) + 3(-285.8) - 3\Delta H_f^{\circ}(C_3H_6O(l))

Solving for ΔHf(C3H6O(l))\Delta H_f^{\circ}(C_3H_6O(l)), we get:

ΔHf(C3H6O(l))=3(393.5)+3(285.8)+1790\Delta H_f^{\circ}(C_3H_6O(l)) = 3(-393.5) + 3(-285.8) + 1790

ΔHf(C3H6O(l))=1181.5857.4+1790\Delta H_f^{\circ}(C_3H_6O(l)) = -1181.5 - 857.4 + 1790

ΔHf(C3H6O(l))=751\Delta H_f^{\circ}(C_3H_6O(l)) = 751

Therefore, the standard enthalpy of formation for C3H6OC_3H_6O is 751 kJ/mol.

Conclusion

Introduction

In our previous article, we explored how to calculate the standard enthalpy of formation for a given compound using the standard enthalpy change of a reaction. We used the given information to calculate the standard enthalpy of formation for C3H6OC_3H_6O and found it to be 751 kJ/mol. In this article, we will answer some frequently asked questions related to thermochemical calculations and the standard enthalpy of formation.

Q: What is the standard enthalpy of formation?

A: The standard enthalpy of formation, denoted as ΔHf\Delta H_f^{\circ}, is the change in enthalpy that occurs when one mole of a substance is formed from its constituent elements in their standard states.

Q: How is the standard enthalpy of formation calculated?

A: The standard enthalpy of formation is calculated using the standard enthalpy change of a reaction. The standard enthalpy change is given by:

ΔH=ΔHf(products)ΔHf(reactants)\Delta H^{\circ} = \sum \Delta H_f^{\circ}(\text{products}) - \sum \Delta H_f^{\circ}(\text{reactants})

Q: What is the difference between the standard enthalpy of formation and the standard enthalpy change?

A: The standard enthalpy of formation is the change in enthalpy that occurs when one mole of a substance is formed from its constituent elements in their standard states. The standard enthalpy change is the change in enthalpy that occurs during a chemical reaction.

Q: How do I determine the standard enthalpy of formation for a compound that is not listed in a table of standard enthalpies of formation?

A: To determine the standard enthalpy of formation for a compound that is not listed in a table of standard enthalpies of formation, you can use the standard enthalpy change of a reaction that involves the compound. You can then use the standard enthalpy change to calculate the standard enthalpy of formation for the compound.

Q: What are some common sources of error in thermochemical calculations?

A: Some common sources of error in thermochemical calculations include:

  • Incorrect values for the standard enthalpy changes of the reactants and products
  • Failure to account for the standard states of the reactants and products
  • Failure to account for the stoichiometry of the reaction
  • Failure to account for the temperature and pressure of the reaction

Q: How can I improve the accuracy of my thermochemical calculations?

A: To improve the accuracy of your thermochemical calculations, you can:

  • Use reliable sources of data for the standard enthalpy changes of the reactants and products
  • Ensure that you are using the correct values for the standard enthalpy changes of the reactants and products
  • Account for the standard states of the reactants and products
  • Account for the stoichiometry of the reaction
  • Account for the temperature and pressure of the reaction

Conclusion

In this article, we have answered some frequently asked questions related to thermochemical calculations and the standard enthalpy of formation. We have discussed the standard enthalpy of formation, how it is calculated, and some common sources of error in thermochemical calculations. We have also provided some tips for improving the accuracy of your thermochemical calculations.

Additional Resources

For more information on thermochemical calculations and the standard enthalpy of formation, you can consult the following resources:

  • "Thermochemistry" by David R. Lide
  • "Physical Chemistry" by Peter Atkins and Julio de Paula
  • "Thermochemical Data of Pure Substances" by I. Barin and O. Knacke

Glossary

  • Standard enthalpy of formation: The change in enthalpy that occurs when one mole of a substance is formed from its constituent elements in their standard states.
  • Standard enthalpy change: The change in enthalpy that occurs during a chemical reaction.
  • Standard state: The state of a substance at a temperature of 25°C and a pressure of 1 atm.
  • Stoichiometry: The quantitative relationships between the reactants and products in a chemical reaction.