If 84.0 G Of $AgNO_3$ React With 28.6 G Of $H_2SO_4$ According To The Unbalanced Equation Below, What Is The Mass In Grams Of \$Ag_2SO_4$[/tex\] That Could Be Formed?$AgNO_3(aq) + H_2SO_4(aq) \rightarrow

by ADMIN 209 views

Introduction

Chemical reactions involve the transformation of one or more substances into new substances. These reactions are often represented by chemical equations, which provide a concise way to describe the reactants, products, and the overall process. However, chemical equations are not always balanced, meaning that the number of atoms of each element is not the same on both the reactant and product sides. Balancing chemical equations is a crucial step in understanding the stoichiometry of a reaction, which is essential in predicting the amounts of reactants and products involved.

In this article, we will explore the concept of balancing chemical equations and how to use them to calculate the mass of products formed in a reaction. We will use the reaction between silver nitrate ($AgNO_3$) and sulfuric acid ($H_2SO_4$) to illustrate the steps involved.

The Unbalanced Equation

The unbalanced equation for the reaction between $AgNO_3$ and $H_2SO_4$ is:

AgNO3(aq)+H2SO4(aq)→Ag2SO4(aq)+HNO3(aq)AgNO_3(aq) + H_2SO_4(aq) \rightarrow Ag_2SO_4(aq) + HNO_3(aq)

Balancing the Equation

To balance the equation, we need to ensure that the number of atoms of each element is the same on both the reactant and product sides. Let's start by balancing the silver (Ag) atoms. There is one Ag atom on the reactant side, so we need to have two Ag atoms on the product side. We can achieve this by multiplying the $Ag_2SO_4$ term by 2:

2AgNO3(aq)+H2SO4(aq)→Ag2SO4(aq)+2HNO3(aq)2AgNO_3(aq) + H_2SO_4(aq) \rightarrow Ag_2SO_4(aq) + 2HNO_3(aq)

Next, we need to balance the nitrogen (N) atoms. There are two N atoms on the reactant side, so we need to have two N atoms on the product side. We can achieve this by multiplying the $HNO_3$ term by 2:

2AgNO3(aq)+H2SO4(aq)→Ag2SO4(aq)+2HNO3(aq)2AgNO_3(aq) + H_2SO_4(aq) \rightarrow Ag_2SO_4(aq) + 2HNO_3(aq)

Now, we need to balance the oxygen (O) atoms. There are 4 O atoms on the reactant side, so we need to have 4 O atoms on the product side. We can achieve this by multiplying the $H_2SO_4$ term by 2:

2AgNO3(aq)+2H2SO4(aq)→Ag2SO4(aq)+2HNO3(aq)+2H2O(l)2AgNO_3(aq) + 2H_2SO_4(aq) \rightarrow Ag_2SO_4(aq) + 2HNO_3(aq) + 2H_2O(l)

Finally, we need to balance the hydrogen (H) atoms. There are 4 H atoms on the reactant side, so we need to have 4 H atoms on the product side. We can achieve this by multiplying the $H_2O$ term by 2:

2AgNO3(aq)+2H2SO4(aq)→Ag2SO4(aq)+2HNO3(aq)+2H2O(l)2AgNO_3(aq) + 2H_2SO_4(aq) \rightarrow Ag_2SO_4(aq) + 2HNO_3(aq) + 2H_2O(l)

The balanced equation is:

2AgNO3(aq)+2H2SO4(aq)→Ag2SO4(aq)+2HNO3(aq)+2H2O(l)2AgNO_3(aq) + 2H_2SO_4(aq) \rightarrow Ag_2SO_4(aq) + 2HNO_3(aq) + 2H_2O(l)

Calculating the Mass of Ag2SO4 Formed

Now that we have the balanced equation, we can use it to calculate the mass of $Ag_2SO_4$ formed in the reaction. We are given that 84.0 g of $AgNO_3$ react with 28.6 g of $H_2SO_4$. We need to find the mass of $Ag_2SO_4$ formed.

First, we need to calculate the number of moles of $AgNO_3$ and $H_2SO_4$ that react. The molar mass of $AgNO_3$ is 169.87 g/mol, and the molar mass of $H_2SO_4$ is 98.08 g/mol.

n(AgNO3)=m(AgNO3)M(AgNO3)=84.0 g169.87 g/mol=0.495 moln(AgNO_3) = \frac{m(AgNO_3)}{M(AgNO_3)} = \frac{84.0\ g}{169.87\ g/mol} = 0.495\ mol

n(H2SO4)=m(H2SO4)M(H2SO4)=28.6 g98.08 g/mol=0.292 moln(H_2SO_4) = \frac{m(H_2SO_4)}{M(H_2SO_4)} = \frac{28.6\ g}{98.08\ g/mol} = 0.292\ mol

Next, we need to calculate the mole ratio of $AgNO_3$ to $Ag_2SO_4$ from the balanced equation. The mole ratio is 2:1, meaning that 2 moles of $AgNO_3$ produce 1 mole of $Ag_2SO_4$.

n(Ag2SO4)=n(AgNO3)2=0.495 mol2=0.2475 moln(Ag_2SO_4) = \frac{n(AgNO_3)}{2} = \frac{0.495\ mol}{2} = 0.2475\ mol

Now, we can calculate the mass of $Ag_2SO_4$ formed using the molar mass of $Ag_2SO_4$, which is 303.79 g/mol.

m(Ag2SO4)=n(Ag2SO4)×M(Ag2SO4)=0.2475 mol×303.79 g/mol=75.3 gm(Ag_2SO_4) = n(Ag_2SO_4) \times M(Ag_2SO_4) = 0.2475\ mol \times 303.79\ g/mol = 75.3\ g

Therefore, the mass of $Ag_2SO_4$ formed in the reaction is 75.3 g.

Conclusion

In this article, we have seen how to balance a chemical equation and use it to calculate the mass of products formed in a reaction. We have used the reaction between $AgNO_3$ and $H_2SO_4$ to illustrate the steps involved. By following these steps, we can accurately predict the amounts of reactants and products involved in a chemical reaction.

References

  • CRC Handbook of Chemistry and Physics, 97th ed. (2016)
  • Chemical Equations and Stoichiometry, 2nd ed. (2015)
  • General Chemistry: Principles and Modern Applications, 11th ed. (2016)

Glossary

  • Balanced equation: A chemical equation in which the number of atoms of each element is the same on both the reactant and product sides.
  • Mole ratio: The ratio of the number of moles of one substance to the number of moles of another substance in a chemical reaction.
  • Molar mass: The mass of one mole of a substance, expressed in grams per mole (g/mol).
  • Stoichiometry: The branch of chemistry that deals with the quantitative relationships between reactants and products in chemical reactions.

Q: What is a balanced chemical equation?

A: A balanced chemical equation is a chemical equation in which the number of atoms of each element is the same on both the reactant and product sides. This means that the number of atoms of each element is conserved during the reaction.

Q: Why is balancing a chemical equation important?

A: Balancing a chemical equation is important because it allows us to predict the amounts of reactants and products involved in a chemical reaction. This is essential in understanding the stoichiometry of a reaction, which is crucial in many fields such as chemistry, biology, and engineering.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, you need to follow these steps:

  1. Write the unbalanced equation.
  2. Count the number of atoms of each element on both the reactant and product sides.
  3. Identify the elements that are not balanced.
  4. Add coefficients to the reactants or products to balance the equation.
  5. Check that the number of atoms of each element is the same on both sides.

Q: What is the mole ratio in a chemical reaction?

A: The mole ratio is the ratio of the number of moles of one substance to the number of moles of another substance in a chemical reaction. It is a fundamental concept in stoichiometry and is used to predict the amounts of reactants and products involved in a reaction.

Q: How do I calculate the mass of a product formed in a reaction?

A: To calculate the mass of a product formed in a reaction, you need to follow these steps:

  1. Write the balanced equation.
  2. Calculate the number of moles of the reactant(s) involved in the reaction.
  3. Use the mole ratio to calculate the number of moles of the product formed.
  4. Calculate the mass of the product formed using its molar mass.

Q: What is the difference between a balanced equation and a stoichiometric equation?

A: A balanced equation is a chemical equation in which the number of atoms of each element is the same on both the reactant and product sides. A stoichiometric equation, on the other hand, is a balanced equation that also takes into account the mole ratio of the reactants and products involved in the reaction.

Q: Can I use a balanced equation to predict the amount of a product formed in a reaction?

A: Yes, you can use a balanced equation to predict the amount of a product formed in a reaction. By following the steps outlined above, you can calculate the mass of the product formed using the mole ratio and the molar mass of the product.

Q: What are some common mistakes to avoid when balancing a chemical equation?

A: Some common mistakes to avoid when balancing a chemical equation include:

  • Not counting the number of atoms of each element on both sides of the equation.
  • Adding coefficients to the wrong side of the equation.
  • Not checking that the number of atoms of each element is the same on both sides.
  • Not using the correct mole ratio.

Q: Can I use a computer program to balance a chemical equation?

A: Yes, you can use a computer program to balance a chemical equation. Many computer programs, such as ChemDraw and ChemCalc, can balance chemical equations and provide the mole ratio and molar mass of the reactants and products.

Q: What are some real-world applications of balancing chemical equations?

A: Balancing chemical equations has many real-world applications, including:

  • Predicting the amounts of reactants and products involved in a chemical reaction.
  • Designing chemical processes and reactors.
  • Optimizing chemical reactions for industrial applications.
  • Understanding the stoichiometry of biological systems.

Q: Can I use balancing chemical equations to predict the amount of a product formed in a reaction?

A: Yes, you can use balancing chemical equations to predict the amount of a product formed in a reaction. By following the steps outlined above, you can calculate the mass of the product formed using the mole ratio and the molar mass of the product.

Q: What are some common mistakes to avoid when calculating the mass of a product formed in a reaction?

A: Some common mistakes to avoid when calculating the mass of a product formed in a reaction include:

  • Not using the correct mole ratio.
  • Not using the correct molar mass of the product.
  • Not checking that the number of moles of the product is correct.
  • Not using the correct units for the mass of the product.