If 28.0 Grams Of $Pb \left( NO _3\right)_2$ React With 18.0 Grams Of $NaI$, What Mass Of \$PbI_2$[/tex\] Can Be Produced?Given Reaction: $Pb\left(NO_3\right)_2 + 2NaI \rightarrow PbI_2 + 2NaNO_3$A.

by ADMIN 205 views

Understanding the Problem

In this problem, we are given a chemical reaction between lead(II) nitrate ($Pb\left(NO_3\right)_2$) and sodium iodide ($NaI$) to produce lead(II) iodide ($PbI_2$) and sodium nitrate ($NaNO_3$). We are asked to determine the mass of $PbI_2$ that can be produced when 28.0 grams of $Pb\left(NO_3\right)_2$ react with 18.0 grams of $NaI$.

Balancing the Chemical Equation

The given reaction is:

Pb(NO3)2+2NaI→PbI2+2NaNO3Pb\left(NO_3\right)_2 + 2NaI \rightarrow PbI_2 + 2NaNO_3

To balance the equation, we need to ensure that the number of atoms of each element is the same on both the reactant and product sides. In this case, the equation is already balanced.

Calculating the Number of Moles of Reactants

To determine the mass of $PbI_2$ produced, we need to calculate the number of moles of each reactant. We can use the molar masses of the reactants to do this.

The molar mass of $Pb\left(NO_3\right)_2$ is 331.2 g/mol, and the molar mass of $NaI$ is 149.9 g/mol.

We can calculate the number of moles of each reactant as follows:

nPb(NO3)2=mPb(NO3)2MPb(NO3)2=28.0 g331.2 g/mol=0.0845 moln_{Pb(NO_3)_2} = \frac{m_{Pb(NO_3)_2}}{M_{Pb(NO_3)_2}} = \frac{28.0 \text{ g}}{331.2 \text{ g/mol}} = 0.0845 \text{ mol}

nNaI=mNaIMNaI=18.0 g149.9 g/mol=0.120 moln_{NaI} = \frac{m_{NaI}}{M_{NaI}} = \frac{18.0 \text{ g}}{149.9 \text{ g/mol}} = 0.120 \text{ mol}

Determining the Limiting Reactant

To determine the limiting reactant, we need to compare the mole ratio of the reactants to the coefficients in the balanced equation.

The balanced equation shows that 1 mole of $Pb\left(NO_3\right)_2$ reacts with 2 moles of $NaI$.

We can calculate the mole ratio of the reactants as follows:

nNaInPb(NO3)2=0.120 mol0.0845 mol=1.42\frac{n_{NaI}}{n_{Pb(NO_3)_2}} = \frac{0.120 \text{ mol}}{0.0845 \text{ mol}} = 1.42

Since the mole ratio is less than 2, $NaI$ is the limiting reactant.

Calculating the Mass of PbI2 Produced

Now that we have determined the limiting reactant, we can calculate the mass of $PbI_2$ produced.

The molar mass of $PbI_2$ is 461.0 g/mol.

We can calculate the number of moles of $PbI_2$ produced as follows:

nPbI2=nNaI=0.120 moln_{PbI_2} = n_{NaI} = 0.120 \text{ mol}

We can then calculate the mass of $PbI_2$ produced as follows:

mPbI2=nPbI2×MPbI2=0.120 mol×461.0 g/mol=55.3 gm_{PbI_2} = n_{PbI_2} \times M_{PbI_2} = 0.120 \text{ mol} \times 461.0 \text{ g/mol} = 55.3 \text{ g}

Conclusion

In this problem, we used the concept of balancing chemical equations and stoichiometry to determine the mass of $PbI_2$ produced when 28.0 grams of $Pb\left(NO_3\right)_2$ react with 18.0 grams of $NaI$. We first balanced the chemical equation, then calculated the number of moles of each reactant, determined the limiting reactant, and finally calculated the mass of $PbI_2$ produced.

Key Takeaways

  • Balancing chemical equations is essential to ensure that the number of atoms of each element is the same on both the reactant and product sides.
  • Stoichiometry is the study of the quantitative relationships between reactants and products in chemical reactions.
  • The limiting reactant is the reactant that is consumed first in a chemical reaction, and it determines the amount of product that can be formed.

Future Applications

This problem has applications in various fields, including chemistry, physics, and engineering. For example, in the production of semiconductors, the reaction between lead(II) nitrate and sodium iodide is used to form lead(II) iodide, which is a key component in the manufacture of semiconductors.

Limitations and Future Research Directions

One limitation of this problem is that it assumes that the reaction is carried out in a perfectly stoichiometric manner, which is not always the case in real-world applications. Future research directions could include investigating the effects of impurities and other factors on the reaction.

Conclusion

In conclusion, this problem demonstrates the importance of balancing chemical equations and stoichiometry in determining the mass of products formed in chemical reactions. By understanding these concepts, we can better design and optimize chemical reactions to produce the desired products in the most efficient manner possible.

Q: What is the difference between balancing a chemical equation and stoichiometry?

A: Balancing a chemical equation involves ensuring that the number of atoms of each element is the same on both the reactant and product sides. Stoichiometry, on the other hand, is the study of the quantitative relationships between reactants and products in chemical reactions.

Q: Why is balancing a chemical equation important?

A: Balancing a chemical equation is essential to ensure that the number of atoms of each element is the same on both the reactant and product sides. This is important because it allows us to predict the amount of product that will be formed from a given amount of reactants.

Q: How do I determine the limiting reactant in a chemical reaction?

A: To determine the limiting reactant, you need to compare the mole ratio of the reactants to the coefficients in the balanced equation. The reactant that is consumed first in a chemical reaction is the limiting reactant.

Q: What is the mole ratio of reactants in a chemical reaction?

A: The mole ratio of reactants is the ratio of the number of moles of each reactant to the number of moles of the other reactant. This ratio is used to determine the limiting reactant in a chemical reaction.

Q: How do I calculate the mass of a product formed in a chemical reaction?

A: To calculate the mass of a product formed in a chemical reaction, you need to know the number of moles of the product and its molar mass. You can then use the formula: mass = number of moles x molar mass.

Q: What is the difference between a balanced equation and an unbalanced equation?

A: A balanced equation is an equation in which the number of atoms of each element is the same on both the reactant and product sides. An unbalanced equation, on the other hand, is an equation in which the number of atoms of each element is not the same on both the reactant and product sides.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, you need to add coefficients in front of the formulas of the reactants and products to ensure that the number of atoms of each element is the same on both the reactant and product sides.

Q: What is the importance of stoichiometry in chemistry?

A: Stoichiometry is the study of the quantitative relationships between reactants and products in chemical reactions. It is essential in chemistry because it allows us to predict the amount of product that will be formed from a given amount of reactants.

Q: How do I determine the number of moles of a reactant in a chemical reaction?

A: To determine the number of moles of a reactant in a chemical reaction, you need to know the mass of the reactant and its molar mass. You can then use the formula: number of moles = mass / molar mass.

Q: What is the difference between a mole and a gram?

A: A mole is a unit of measurement that represents 6.022 x 10^23 particles (atoms or molecules). A gram, on the other hand, is a unit of mass that represents 1/1000 of a kilogram.

Q: How do I calculate the mass of a reactant in a chemical reaction?

A: To calculate the mass of a reactant in a chemical reaction, you need to know the number of moles of the reactant and its molar mass. You can then use the formula: mass = number of moles x molar mass.

Q: What is the importance of balancing a chemical equation?

A: Balancing a chemical equation is essential to ensure that the number of atoms of each element is the same on both the reactant and product sides. This is important because it allows us to predict the amount of product that will be formed from a given amount of reactants.

Q: How do I determine the limiting reactant in a chemical reaction?

A: To determine the limiting reactant, you need to compare the mole ratio of the reactants to the coefficients in the balanced equation. The reactant that is consumed first in a chemical reaction is the limiting reactant.

Q: What is the mole ratio of reactants in a chemical reaction?

A: The mole ratio of reactants is the ratio of the number of moles of each reactant to the number of moles of the other reactant. This ratio is used to determine the limiting reactant in a chemical reaction.

Q: How do I calculate the mass of a product formed in a chemical reaction?

A: To calculate the mass of a product formed in a chemical reaction, you need to know the number of moles of the product and its molar mass. You can then use the formula: mass = number of moles x molar mass.

Q: What is the difference between a balanced equation and an unbalanced equation?

A: A balanced equation is an equation in which the number of atoms of each element is the same on both the reactant and product sides. An unbalanced equation, on the other hand, is an equation in which the number of atoms of each element is not the same on both the reactant and product sides.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, you need to add coefficients in front of the formulas of the reactants and products to ensure that the number of atoms of each element is the same on both the reactant and product sides.

Q: What is the importance of stoichiometry in chemistry?

A: Stoichiometry is the study of the quantitative relationships between reactants and products in chemical reactions. It is essential in chemistry because it allows us to predict the amount of product that will be formed from a given amount of reactants.

Q: How do I determine the number of moles of a reactant in a chemical reaction?

A: To determine the number of moles of a reactant in a chemical reaction, you need to know the mass of the reactant and its molar mass. You can then use the formula: number of moles = mass / molar mass.

Q: What is the difference between a mole and a gram?

A: A mole is a unit of measurement that represents 6.022 x 10^23 particles (atoms or molecules). A gram, on the other hand, is a unit of mass that represents 1/1000 of a kilogram.

Q: How do I calculate the mass of a reactant in a chemical reaction?

A: To calculate the mass of a reactant in a chemical reaction, you need to know the number of moles of the reactant and its molar mass. You can then use the formula: mass = number of moles x molar mass.

Q: What is the importance of balancing a chemical equation?

A: Balancing a chemical equation is essential to ensure that the number of atoms of each element is the same on both the reactant and product sides. This is important because it allows us to predict the amount of product that will be formed from a given amount of reactants.

Q: How do I determine the limiting reactant in a chemical reaction?

A: To determine the limiting reactant, you need to compare the mole ratio of the reactants to the coefficients in the balanced equation. The reactant that is consumed first in a chemical reaction is the limiting reactant.

Q: What is the mole ratio of reactants in a chemical reaction?

A: The mole ratio of reactants is the ratio of the number of moles of each reactant to the number of moles of the other reactant. This ratio is used to determine the limiting reactant in a chemical reaction.

Q: How do I calculate the mass of a product formed in a chemical reaction?

A: To calculate the mass of a product formed in a chemical reaction, you need to know the number of moles of the product and its molar mass. You can then use the formula: mass = number of moles x molar mass.

Q: What is the difference between a balanced equation and an unbalanced equation?

A: A balanced equation is an equation in which the number of atoms of each element is the same on both the reactant and product sides. An unbalanced equation, on the other hand, is an equation in which the number of atoms of each element is not the same on both the reactant and product sides.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, you need to add coefficients in front of the formulas of the reactants and products to ensure that the number of atoms of each element is the same on both the reactant and product sides.

Q: What is the importance of stoichiometry in chemistry?

A: Stoichiometry is the study of the quantitative relationships between reactants and products in chemical reactions. It is essential in chemistry because it allows us to predict the amount of product that will be formed from a given amount of reactants.

Q: How do I determine the number of moles of a reactant in a chemical reaction?

A: To determine the number of moles of a reactant in a chemical reaction, you need to know the mass of the reactant and its molar mass. You can then use the formula: number of moles = mass / molar mass.

Q: What is the difference between a mole and a gram?

A: A mole is a