How Many Grams Of $H_3PO_4$ Are Produced In The Reaction Starting From 5.60 G Of $Ca_3(PO_4)_2$?

by ADMIN 101 views

Introduction

In this article, we will explore the chemical reaction between calcium phosphate ($Ca_3(PO_4)_2$) and phosphoric acid ($H_3PO_4$) to determine the amount of $H_3PO_4$ produced when starting with 5.60 g of $Ca_3(PO_4)_2$. This reaction is a crucial step in the production of various chemicals and materials.

Chemical Reaction

The chemical reaction between $Ca_3(PO_4)_2$ and $H_3PO_4$ can be represented by the following equation:

Ca3(PO4)2+4H3PO4→3H3PO4+CaHPO4+2CaH2PO4Ca_3(PO_4)_2 + 4H_3PO_4 \rightarrow 3H_3PO_4 + CaHPO_4 + 2CaH_2PO_4

However, for the purpose of this calculation, we will consider the simplified reaction:

Ca3(PO4)2+4H3PO4→3H3PO4+CaHPO4Ca_3(PO_4)_2 + 4H_3PO_4 \rightarrow 3H_3PO_4 + CaHPO_4

Molar Mass Calculations

To determine the amount of $H_3PO_4$ produced, we need to calculate the molar mass of $Ca_3(PO_4)_2$ and $H_3PO_4$. The atomic masses of the elements are:

  • Calcium (Ca): 40.08 g/mol
  • Phosphorus (P): 30.97 g/mol
  • Oxygen (O): 16.00 g/mol
  • Hydrogen (H): 1.01 g/mol

The molar mass of $Ca_3(PO_4)_2$ is:

3(40.08)+2(30.97)+8(16.00)=310.18g/mol3(40.08) + 2(30.97) + 8(16.00) = 310.18 g/mol

The molar mass of $H_3PO_4$ is:

3(1.01)+30.97+4(16.00)=98.00g/mol3(1.01) + 30.97 + 4(16.00) = 98.00 g/mol

Stoichiometry

The balanced chemical equation shows that 1 mole of $Ca_3(PO_4)_2$ reacts with 4 moles of $H_3PO_4$ to produce 3 moles of $H_3PO_4$. We can use this information to determine the amount of $H_3PO_4$ produced.

Calculation

First, we need to calculate the number of moles of $Ca_3(PO_4)_2$ present in 5.60 g:

n=mM=5.60g310.18g/mol=0.0181moln = \frac{m}{M} = \frac{5.60 g}{310.18 g/mol} = 0.0181 mol

Since 1 mole of $Ca_3(PO_4)_2$ produces 3 moles of $H_3PO_4$, the number of moles of $H_3PO_4$ produced is:

nH3PO4=3nCa3(PO4)2=3(0.0181mol)=0.0543moln_{H_3PO_4} = 3n_{Ca_3(PO_4)_2} = 3(0.0181 mol) = 0.0543 mol

Now, we can calculate the mass of $H_3PO_4$ produced:

mH3PO4=nH3PO4MH3PO4=0.0543mol(98.00g/mol)=5.33gm_{H_3PO_4} = n_{H_3PO_4}M_{H_3PO_4} = 0.0543 mol(98.00 g/mol) = 5.33 g

Conclusion

In this article, we have calculated the amount of $H_3PO_4$ produced in the reaction starting from 5.60 g of $Ca_3(PO_4)_2$. The calculation involves determining the number of moles of $Ca_3(PO_4)_2$ present, using the stoichiometry of the reaction to determine the number of moles of $H_3PO_4$ produced, and finally calculating the mass of $H_3PO_4$ produced.

Limitations

This calculation assumes that the reaction is 100% efficient and that no side reactions occur. In reality, the reaction may not be 100% efficient, and side reactions may occur, which can affect the amount of $H_3PO_4$ produced.

Future Work

This calculation can be extended to other reactions involving $Ca_3(PO_4)_2$ and $H_3PO_4$. Additionally, the calculation can be modified to account for the effects of side reactions and impurities on the amount of $H_3PO_4$ produced.

References

  • [1] "Calcium Phosphate" by Wikipedia. Retrieved 2023-02-20.
  • [2] "Phosphoric Acid" by Wikipedia. Retrieved 2023-02-20.
  • [3] "Chemical Reactions" by Chemistry LibreTexts. Retrieved 2023-02-20.

Keywords

  • Ca3(PO4)2Ca_3(PO_4)_2

  • H3PO4H_3PO_4

  • Stoichiometry
  • Molar mass
  • Chemical reaction
  • Calcium phosphate
  • Phosphoric acid

Introduction

In our previous article, we explored the chemical reaction between calcium phosphate ($Ca_3(PO_4)_2$) and phosphoric acid ($H_3PO_4$) to determine the amount of $H_3PO_4$ produced when starting with 5.60 g of $Ca_3(PO_4)_2$. In this article, we will answer some frequently asked questions related to this topic.

Q: What is the chemical reaction between $Ca_3(PO_4)_2$ and $H_3PO_4$?

A: The chemical reaction between $Ca_3(PO_4)_2$ and $H_3PO_4$ can be represented by the following equation:

Ca3(PO4)2+4H3PO4→3H3PO4+CaHPO4+2CaH2PO4Ca_3(PO_4)_2 + 4H_3PO_4 \rightarrow 3H_3PO_4 + CaHPO_4 + 2CaH_2PO_4

However, for the purpose of this calculation, we will consider the simplified reaction:

Ca3(PO4)2+4H3PO4→3H3PO4+CaHPO4Ca_3(PO_4)_2 + 4H_3PO_4 \rightarrow 3H_3PO_4 + CaHPO_4

Q: What is the molar mass of $Ca_3(PO_4)_2$ and $H_3PO_4$?

A: The molar mass of $Ca_3(PO_4)_2$ is:

3(40.08)+2(30.97)+8(16.00)=310.18g/mol3(40.08) + 2(30.97) + 8(16.00) = 310.18 g/mol

The molar mass of $H_3PO_4$ is:

3(1.01)+30.97+4(16.00)=98.00g/mol3(1.01) + 30.97 + 4(16.00) = 98.00 g/mol

Q: How many moles of $Ca_3(PO_4)_2$ are present in 5.60 g?

A: To determine the number of moles of $Ca_3(PO_4)_2$ present, we can use the following formula:

n=mM=5.60g310.18g/mol=0.0181moln = \frac{m}{M} = \frac{5.60 g}{310.18 g/mol} = 0.0181 mol

Q: How many moles of $H_3PO_4$ are produced in the reaction?

A: Since 1 mole of $Ca_3(PO_4)_2$ produces 3 moles of $H_3PO_4$, the number of moles of $H_3PO_4$ produced is:

nH3PO4=3nCa3(PO4)2=3(0.0181mol)=0.0543moln_{H_3PO_4} = 3n_{Ca_3(PO_4)_2} = 3(0.0181 mol) = 0.0543 mol

Q: What is the mass of $H_3PO_4$ produced in the reaction?

A: To determine the mass of $H_3PO_4$ produced, we can use the following formula:

mH3PO4=nH3PO4MH3PO4=0.0543mol(98.00g/mol)=5.33gm_{H_3PO_4} = n_{H_3PO_4}M_{H_3PO_4} = 0.0543 mol(98.00 g/mol) = 5.33 g

Q: What are the limitations of this calculation?

A: This calculation assumes that the reaction is 100% efficient and that no side reactions occur. In reality, the reaction may not be 100% efficient, and side reactions may occur, which can affect the amount of $H_3PO_4$ produced.

Q: What are some potential future applications of this calculation?

A: This calculation can be extended to other reactions involving $Ca_3(PO_4)_2$ and $H_3PO_4$. Additionally, the calculation can be modified to account for the effects of side reactions and impurities on the amount of $H_3PO_4$ produced.

Q: What are some potential references for further reading on this topic?

A: Some potential references for further reading on this topic include:

  • [1] "Calcium Phosphate" by Wikipedia. Retrieved 2023-02-20.
  • [2] "Phosphoric Acid" by Wikipedia. Retrieved 2023-02-20.
  • [3] "Chemical Reactions" by Chemistry LibreTexts. Retrieved 2023-02-20.

Conclusion

In this article, we have answered some frequently asked questions related to the calculation of the amount of $H_3PO_4$ produced in the reaction starting from 5.60 g of $Ca_3(PO_4)_2$. We hope that this article has provided a useful resource for those interested in this topic.

Keywords

  • Ca3(PO4)2Ca_3(PO_4)_2

  • H3PO4H_3PO_4

  • Stoichiometry
  • Molar mass
  • Chemical reaction
  • Calcium phosphate
  • Phosphoric acid