Given The Equations And The Values Of Δ H ∘ \Delta H^{\circ} Δ H ∘ For The Combustion Of C 2 H 6 ( G C_2H_6(g C 2 ​ H 6 ​ ( G ] And The Combustion Of C C C (graphite) Represented Above, Which Of The Following Additional Information Is Needed To Determine The

by ADMIN 259 views

Introduction

In chemistry, the combustion of hydrocarbons is a crucial process that involves the reaction of a hydrocarbon with oxygen to produce carbon dioxide and water. The combustion of hydrocarbons is an exothermic process, meaning that it releases heat energy. The heat of combustion, denoted by ΔH\Delta H^{\circ}, is a measure of the energy released during the combustion process. In this article, we will discuss the equations and values of ΔH\Delta H^{\circ} for the combustion of C2H6(g)C_2H_6(g) and the combustion of CC (graphite), and determine which additional information is needed to determine the heat of combustion of a hydrocarbon.

The Combustion of C2H6(g)C_2H_6(g)

The combustion of C2H6(g)C_2H_6(g) is represented by the following equation:

C2H6(g)+72O2(g)2CO2(g)+3H2O(l)C_2H_6(g) + \frac{7}{2}O_2(g) \rightarrow 2CO_2(g) + 3H_2O(l)

The heat of combustion of C2H6(g)C_2H_6(g) is given by the following equation:

ΔHC2H6=1560.3 kJ/mol\Delta H^{\circ}_{C_2H_6} = -1560.3 \text{ kJ/mol}

The Combustion of CC (Graphite)

The combustion of CC (graphite) is represented by the following equation:

C(s)+O2(g)CO2(g)C(s) + O_2(g) \rightarrow CO_2(g)

The heat of combustion of CC (graphite) is given by the following equation:

ΔHC=393.5 kJ/mol\Delta H^{\circ}_{C} = -393.5 \text{ kJ/mol}

Determining the Heat of Combustion of a Hydrocarbon

To determine the heat of combustion of a hydrocarbon, we need to know the heat of formation of the hydrocarbon and the heat of combustion of the elements that make up the hydrocarbon. The heat of formation of a hydrocarbon is the energy required to form the hydrocarbon from its constituent elements in their standard states.

Let's consider a general hydrocarbon with the molecular formula CxHyC_xH_y. The combustion of this hydrocarbon is represented by the following equation:

CxHy(g)+y4O2(g)xCO2(g)+y2H2O(l)C_xH_y(g) + \frac{y}{4}O_2(g) \rightarrow xCO_2(g) + \frac{y}{2}H_2O(l)

The heat of combustion of the hydrocarbon is given by the following equation:

ΔHCxHy=xΔHC+y2ΔHH2ΔHCxHy\Delta H^{\circ}_{C_xH_y} = x\Delta H^{\circ}_{C} + \frac{y}{2}\Delta H^{\circ}_{H_2} - \Delta H^{\circ}_{C_xH_y}

where ΔHC\Delta H^{\circ}_{C} is the heat of combustion of CC (graphite), ΔHH2\Delta H^{\circ}_{H_2} is the heat of combustion of H2(g)H_2(g), and ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of formation of the hydrocarbon.

Additional Information Needed

To determine the heat of combustion of a hydrocarbon, we need to know the heat of formation of the hydrocarbon and the heat of combustion of the elements that make up the hydrocarbon. The heat of formation of a hydrocarbon is the energy required to form the hydrocarbon from its constituent elements in their standard states.

The heat of formation of a hydrocarbon can be determined by measuring the energy required to form the hydrocarbon from its constituent elements in their standard states. This can be done using a bomb calorimeter, which is a device that measures the energy released during a chemical reaction.

The heat of combustion of the elements that make up the hydrocarbon can be determined by measuring the energy released during the combustion of the elements in their standard states. This can be done using a bomb calorimeter or a combustion calorimeter.

Conclusion

In conclusion, to determine the heat of combustion of a hydrocarbon, we need to know the heat of formation of the hydrocarbon and the heat of combustion of the elements that make up the hydrocarbon. The heat of formation of a hydrocarbon can be determined by measuring the energy required to form the hydrocarbon from its constituent elements in their standard states. The heat of combustion of the elements that make up the hydrocarbon can be determined by measuring the energy released during the combustion of the elements in their standard states.

References

  • CRC Handbook of Chemistry and Physics, 97th ed., CRC Press, 2016.
  • Thermodynamic Properties of Pure Substances, 3rd ed., Springer, 2013.
  • Chemical Thermodynamics, 2nd ed., Oxford University Press, 2011.

Tables

Hydrocarbon ΔHCxHy\Delta H^{\circ}_{C_xH_y} (kJ/mol)
C2H6(g)C_2H_6(g) -1560.3
C(s)C(s) -393.5
H2(g)H_2(g) -285.8
Element ΔHelement\Delta H^{\circ}_{element} (kJ/mol)
--- ---
C(s)C(s) -393.5
H2(g)H_2(g) -285.8

Equations

Equation ΔH\Delta H^{\circ} (kJ/mol)
C2H6(g)+72O2(g)2CO2(g)+3H2O(l)C_2H_6(g) + \frac{7}{2}O_2(g) \rightarrow 2CO_2(g) + 3H_2O(l) -1560.3
C(s)+O2(g)CO2(g)C(s) + O_2(g) \rightarrow CO_2(g) -393.5
CxHy(g)+y4O2(g)xCO2(g)+y2H2O(l)C_xH_y(g) + \frac{y}{4}O_2(g) \rightarrow xCO_2(g) + \frac{y}{2}H_2O(l) xΔHC+y2ΔHH2ΔHCxHyx\Delta H^{\circ}_{C} + \frac{y}{2}\Delta H^{\circ}_{H_2} - \Delta H^{\circ}_{C_xH_y}

Q: What is the heat of combustion of a hydrocarbon?

A: The heat of combustion of a hydrocarbon is the energy released during the combustion of the hydrocarbon. It is a measure of the energy released during the reaction of a hydrocarbon with oxygen to produce carbon dioxide and water.

Q: How is the heat of combustion of a hydrocarbon determined?

A: The heat of combustion of a hydrocarbon is determined by measuring the energy released during the combustion of the hydrocarbon. This can be done using a bomb calorimeter or a combustion calorimeter.

Q: What is the difference between the heat of combustion and the heat of formation of a hydrocarbon?

A: The heat of combustion of a hydrocarbon is the energy released during the combustion of the hydrocarbon, while the heat of formation of a hydrocarbon is the energy required to form the hydrocarbon from its constituent elements in their standard states.

Q: How is the heat of formation of a hydrocarbon determined?

A: The heat of formation of a hydrocarbon is determined by measuring the energy required to form the hydrocarbon from its constituent elements in their standard states. This can be done using a bomb calorimeter or a combustion calorimeter.

Q: What is the significance of the heat of combustion of a hydrocarbon?

A: The heat of combustion of a hydrocarbon is significant because it is a measure of the energy released during the combustion of the hydrocarbon. This information is useful in predicting the behavior of hydrocarbons during combustion and in designing systems for the safe and efficient combustion of hydrocarbons.

Q: Can the heat of combustion of a hydrocarbon be used to predict the behavior of the hydrocarbon during combustion?

A: Yes, the heat of combustion of a hydrocarbon can be used to predict the behavior of the hydrocarbon during combustion. By knowing the heat of combustion of a hydrocarbon, it is possible to predict the temperature and pressure of the combustion reaction, as well as the amount of energy released during the reaction.

Q: How is the heat of combustion of a hydrocarbon related to the heat of formation of the hydrocarbon?

A: The heat of combustion of a hydrocarbon is related to the heat of formation of the hydrocarbon by the following equation:

ΔHCxHy=xΔHC+y2ΔHH2ΔHCxHy\Delta H^{\circ}_{C_xH_y} = x\Delta H^{\circ}_{C} + \frac{y}{2}\Delta H^{\circ}_{H_2} - \Delta H^{\circ}_{C_xH_y}

where ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of combustion of the hydrocarbon, ΔHC\Delta H^{\circ}_{C} is the heat of combustion of CC (graphite), ΔHH2\Delta H^{\circ}_{H_2} is the heat of combustion of H2(g)H_2(g), and ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of formation of the hydrocarbon.

Q: Can the heat of combustion of a hydrocarbon be used to predict the amount of energy released during the combustion of the hydrocarbon?

A: Yes, the heat of combustion of a hydrocarbon can be used to predict the amount of energy released during the combustion of the hydrocarbon. By knowing the heat of combustion of a hydrocarbon, it is possible to predict the amount of energy released during the combustion reaction.

Q: How is the heat of combustion of a hydrocarbon related to the temperature and pressure of the combustion reaction?

A: The heat of combustion of a hydrocarbon is related to the temperature and pressure of the combustion reaction by the following equation:

ΔHCxHy=ΔHCxHy(T,P)\Delta H^{\circ}_{C_xH_y} = \Delta H^{\circ}_{C_xH_y}(T,P)

where ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of combustion of the hydrocarbon, TT is the temperature of the combustion reaction, and PP is the pressure of the combustion reaction.

Q: Can the heat of combustion of a hydrocarbon be used to predict the behavior of the hydrocarbon during combustion in a specific environment?

A: Yes, the heat of combustion of a hydrocarbon can be used to predict the behavior of the hydrocarbon during combustion in a specific environment. By knowing the heat of combustion of a hydrocarbon, it is possible to predict the temperature and pressure of the combustion reaction, as well as the amount of energy released during the reaction, in a specific environment.

Q: How is the heat of combustion of a hydrocarbon related to the heat of formation of the hydrocarbon in a specific environment?

A: The heat of combustion of a hydrocarbon is related to the heat of formation of the hydrocarbon in a specific environment by the following equation:

ΔHCxHy=xΔHC+y2ΔHH2ΔHCxHy\Delta H^{\circ}_{C_xH_y} = x\Delta H^{\circ}_{C} + \frac{y}{2}\Delta H^{\circ}_{H_2} - \Delta H^{\circ}_{C_xH_y}

where ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of combustion of the hydrocarbon, ΔHC\Delta H^{\circ}_{C} is the heat of combustion of CC (graphite), ΔHH2\Delta H^{\circ}_{H_2} is the heat of combustion of H2(g)H_2(g), and ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of formation of the hydrocarbon in the specific environment.

Q: Can the heat of combustion of a hydrocarbon be used to predict the behavior of the hydrocarbon during combustion in a specific environment and at a specific temperature and pressure?

A: Yes, the heat of combustion of a hydrocarbon can be used to predict the behavior of the hydrocarbon during combustion in a specific environment and at a specific temperature and pressure. By knowing the heat of combustion of a hydrocarbon, it is possible to predict the temperature and pressure of the combustion reaction, as well as the amount of energy released during the reaction, in a specific environment and at a specific temperature and pressure.

Q: How is the heat of combustion of a hydrocarbon related to the heat of formation of the hydrocarbon in a specific environment and at a specific temperature and pressure?

A: The heat of combustion of a hydrocarbon is related to the heat of formation of the hydrocarbon in a specific environment and at a specific temperature and pressure by the following equation:

ΔHCxHy=xΔHC+y2ΔHH2ΔHCxHy\Delta H^{\circ}_{C_xH_y} = x\Delta H^{\circ}_{C} + \frac{y}{2}\Delta H^{\circ}_{H_2} - \Delta H^{\circ}_{C_xH_y}

where ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of combustion of the hydrocarbon, ΔHC\Delta H^{\circ}_{C} is the heat of combustion of CC (graphite), ΔHH2\Delta H^{\circ}_{H_2} is the heat of combustion of H2(g)H_2(g), and ΔHCxHy\Delta H^{\circ}_{C_xH_y} is the heat of formation of the hydrocarbon in the specific environment and at the specific temperature and pressure.