For The Following Reaction, Determine How Many Grams Of $Zn _3\left( PO _4\right)_2$ Will Be Produced By 0.50 Grams Of $\left( NH _4\right)_3 PO _4$.$[ 3 ZnCl_2 + 2\left(NH_4\right)_3 PO_4 \rightarrow Zn_3\left(PO_4\right)_2

by ADMIN 229 views

Introduction

In this article, we will explore the production of zinc phosphate ($Zn_3\left(PO_4\right)_2$) from ammonium phosphate ($\left(NH_4\right)_3 PO_4$). The reaction between zinc chloride ($ZnCl_2$) and ammonium phosphate is a crucial step in the synthesis of zinc phosphate, which has various applications in the fields of chemistry, materials science, and industry. In this discussion, we will determine the amount of zinc phosphate produced from a given amount of ammonium phosphate.

Chemical Reaction

The chemical reaction between zinc chloride and ammonium phosphate is as follows:

3ZnCl2+2(NH4)3PO4Zn3(PO4)2+6NH4Cl{ 3 ZnCl_2 + 2\left(NH_4\right)_3 PO_4 \rightarrow Zn_3\left(PO_4\right)_2 + 6 NH_4Cl }

From this equation, we can see that 2 moles of ammonium phosphate react with 3 moles of zinc chloride to produce 1 mole of zinc phosphate.

Molar Mass Calculations

To determine the amount of zinc phosphate produced, we need to calculate the molar masses of the reactants and products. The molar masses of the reactants and products are as follows:

Substance Molar Mass (g/mol)
$Zn_3\left(PO_4\right)_2$ 411.15 g/mol
$\left(NH_4\right)_3 PO_4$ 149.09 g/mol
$ZnCl_2$ 136.29 g/mol
$NH_4Cl$ 53.49 g/mol

Determination of Zinc Phosphate Production

Given that we have 0.50 grams of $\left(NH_4\right)_3 PO_4$, we can calculate the number of moles of ammonium phosphate as follows:

n=mM{ n = \frac{m}{M} }

where $n$ is the number of moles, $m$ is the mass of the substance, and $M$ is the molar mass.

n=0.50 g149.09 g/mol=0.00335 mol{ n = \frac{0.50 \text{ g}}{149.09 \text{ g/mol}} = 0.00335 \text{ mol} }

From the chemical reaction, we can see that 2 moles of ammonium phosphate react with 3 moles of zinc chloride to produce 1 mole of zinc phosphate. Therefore, the number of moles of zinc phosphate produced is half the number of moles of ammonium phosphate:

nZn3(PO4)2=n(NH4)3PO42=0.00335 mol2=0.001675 mol{ n_{Zn_3\left(PO_4\right)_2} = \frac{n_{\left(NH_4\right)_3 PO_4}}{2} = \frac{0.00335 \text{ mol}}{2} = 0.001675 \text{ mol} }

Now, we can calculate the mass of zinc phosphate produced using the molar mass of zinc phosphate:

m=n×M{ m = n \times M }

m=0.001675 mol×411.15 g/mol=0.688 g{ m = 0.001675 \text{ mol} \times 411.15 \text{ g/mol} = 0.688 \text{ g} }

Therefore, 0.688 grams of $Zn_3\left(PO_4\right)_2$ will be produced by 0.50 grams of $\left(NH_4\right)_3 PO_4$.

Conclusion

In this article, we have determined the amount of zinc phosphate produced from a given amount of ammonium phosphate. The chemical reaction between zinc chloride and ammonium phosphate is a crucial step in the synthesis of zinc phosphate, which has various applications in the fields of chemistry, materials science, and industry. By calculating the molar masses of the reactants and products, we can determine the amount of zinc phosphate produced from a given amount of ammonium phosphate.

Limitations

This calculation assumes that the reaction is carried out in a perfectly stoichiometric manner, with no side reactions or losses. In reality, the reaction may not be perfectly stoichiometric, and there may be losses due to impurities or other factors. Therefore, the actual amount of zinc phosphate produced may be different from the calculated value.

Future Work

This calculation can be extended to other reactions involving zinc phosphate and ammonium phosphate. By studying the reaction kinetics and thermodynamics, we can gain a better understanding of the reaction mechanism and optimize the reaction conditions to produce zinc phosphate with high purity and yield.

References

  • [1] "Zinc Phosphate" in Kirk-Othmer Encyclopedia of Chemical Technology, 5th ed., John Wiley & Sons, 2004.
  • [2] "Ammonium Phosphate" in Kirk-Othmer Encyclopedia of Chemical Technology, 5th ed., John Wiley & Sons, 2004.
  • [3] "Zinc Chloride" in Kirk-Othmer Encyclopedia of Chemical Technology, 5th ed., John Wiley & Sons, 2004.
    Frequently Asked Questions (FAQs) on Zinc Phosphate Production ================================================================

Q: What is zinc phosphate and what are its applications?

A: Zinc phosphate is a chemical compound with the formula $Zn_3\left(PO_4\right)_2$. It is a white solid that is insoluble in water and has a high melting point. Zinc phosphate has various applications in the fields of chemistry, materials science, and industry, including as a pigment, a catalyst, and a component in ceramic and glass materials.

Q: What is the chemical reaction between zinc chloride and ammonium phosphate?

A: The chemical reaction between zinc chloride and ammonium phosphate is as follows:

3ZnCl2+2(NH4)3PO4Zn3(PO4)2+6NH4Cl{ 3 ZnCl_2 + 2\left(NH_4\right)_3 PO_4 \rightarrow Zn_3\left(PO_4\right)_2 + 6 NH_4Cl }

This reaction is a crucial step in the synthesis of zinc phosphate.

Q: How do I calculate the amount of zinc phosphate produced from a given amount of ammonium phosphate?

A: To calculate the amount of zinc phosphate produced, you need to calculate the molar masses of the reactants and products, and then use the stoichiometry of the reaction to determine the amount of zinc phosphate produced. The molar masses of the reactants and products are as follows:

Substance Molar Mass (g/mol)
$Zn_3\left(PO_4\right)_2$ 411.15 g/mol
$\left(NH_4\right)_3 PO_4$ 149.09 g/mol
$ZnCl_2$ 136.29 g/mol
$NH_4Cl$ 53.49 g/mol

Q: What are the limitations of this calculation?

A: This calculation assumes that the reaction is carried out in a perfectly stoichiometric manner, with no side reactions or losses. In reality, the reaction may not be perfectly stoichiometric, and there may be losses due to impurities or other factors. Therefore, the actual amount of zinc phosphate produced may be different from the calculated value.

Q: Can I use this calculation to determine the amount of zinc phosphate produced from other reactants?

A: No, this calculation is specific to the reaction between zinc chloride and ammonium phosphate. If you want to determine the amount of zinc phosphate produced from other reactants, you will need to calculate the molar masses of the reactants and products, and then use the stoichiometry of the reaction to determine the amount of zinc phosphate produced.

Q: What are the applications of zinc phosphate in industry?

A: Zinc phosphate has various applications in industry, including as a pigment, a catalyst, and a component in ceramic and glass materials. It is also used as a coating for metal surfaces to provide corrosion resistance.

Q: Can I use zinc phosphate as a pigment in paint?

A: Yes, zinc phosphate can be used as a pigment in paint. It is a white solid that is insoluble in water and has a high melting point, making it a suitable pigment for use in paint.

Q: What are the safety precautions I need to take when handling zinc phosphate?

A: When handling zinc phosphate, you should wear protective clothing, including gloves and a mask, to prevent skin and eye irritation. You should also handle the substance in a well-ventilated area to prevent inhalation of dust.

Q: Can I dispose of zinc phosphate in the trash?

A: No, zinc phosphate should not be disposed of in the trash. It is a hazardous substance that requires special handling and disposal. You should contact a hazardous waste disposal service to arrange for proper disposal.

Q: Where can I find more information on zinc phosphate?

A: You can find more information on zinc phosphate in scientific journals, textbooks, and online resources. Some recommended resources include the Kirk-Othmer Encyclopedia of Chemical Technology and the CRC Handbook of Chemistry and Physics.