Factor The Expression: P 2 − 6 P + 8 P^2 - 6p + 8 P 2 − 6 P + 8

by ADMIN 64 views

Introduction

Factoring an expression is a fundamental concept in algebra that involves expressing a polynomial as a product of simpler polynomials. In this article, we will focus on factoring the expression p26p+8p^2 - 6p + 8. Factoring expressions is an essential skill in mathematics, and it has numerous applications in various fields, including physics, engineering, and economics.

What is Factoring?

Factoring an expression involves expressing it as a product of two or more polynomials. This can be done in various ways, including factoring out a common factor, factoring by grouping, or using the quadratic formula. Factoring an expression can help simplify it, make it easier to solve, and provide insights into its structure.

The Expression to be Factored

The expression we will be factoring is p26p+8p^2 - 6p + 8. This is a quadratic expression, which means it is a polynomial of degree two. The general form of a quadratic expression is ax2+bx+cax^2 + bx + c, where aa, bb, and cc are constants.

Step 1: Look for a Common Factor

The first step in factoring an expression is to look for a common factor. A common factor is a factor that divides each term of the expression. In this case, there is no common factor that divides each term.

Step 2: Factor by Grouping

The next step is to try factoring by grouping. Factoring by grouping involves grouping the terms of the expression into two or more groups and then factoring out a common factor from each group. In this case, we can group the terms as follows:

p26p+8=(p26p)+8p^2 - 6p + 8 = (p^2 - 6p) + 8

Step 3: Factor Out a Common Factor

Now, we can factor out a common factor from each group. From the first group, we can factor out pp, and from the second group, we can factor out 11.

(p26p)+8=p(p6)+8(p^2 - 6p) + 8 = p(p - 6) + 8

Step 4: Look for a Difference of Squares

Now, we can look for a difference of squares. A difference of squares is a factorization of the form a2b2=(ab)(a+b)a^2 - b^2 = (a - b)(a + b). In this case, we can see that p26pp^2 - 6p is a difference of squares.

p26p=p223p=(p3)29p^2 - 6p = p^2 - 2 \cdot 3 \cdot p = (p - 3)^2 - 9

Step 5: Factor the Difference of Squares

Now, we can factor the difference of squares.

(p3)29=(p33)(p3+3)=(p6)(p0)(p - 3)^2 - 9 = (p - 3 - 3)(p - 3 + 3) = (p - 6)(p - 0)

Step 6: Simplify the Expression

Finally, we can simplify the expression by combining the factors.

p26p+8=(p6)(p0)+8=(p6)(p)+8=p(p6)+8p^2 - 6p + 8 = (p - 6)(p - 0) + 8 = (p - 6)(p) + 8 = p(p - 6) + 8

Conclusion

Factoring the expression p26p+8p^2 - 6p + 8 involves several steps, including looking for a common factor, factoring by grouping, factoring out a common factor, looking for a difference of squares, and factoring the difference of squares. By following these steps, we can simplify the expression and provide insights into its structure.

Real-World Applications

Factoring expressions has numerous real-world applications, including physics, engineering, and economics. For example, in physics, factoring expressions can help simplify complex equations and provide insights into the behavior of physical systems. In engineering, factoring expressions can help design and optimize systems, such as bridges and buildings. In economics, factoring expressions can help model and analyze economic systems, such as supply and demand.

Tips and Tricks

Here are some tips and tricks for factoring expressions:

  • Always look for a common factor first.
  • Use factoring by grouping to simplify complex expressions.
  • Look for a difference of squares to factor expressions of the form a2b2a^2 - b^2.
  • Use the quadratic formula to factor expressions of the form ax2+bx+cax^2 + bx + c.

Common Mistakes

Here are some common mistakes to avoid when factoring expressions:

  • Not looking for a common factor first.
  • Not using factoring by grouping to simplify complex expressions.
  • Not looking for a difference of squares to factor expressions of the form a2b2a^2 - b^2.
  • Not using the quadratic formula to factor expressions of the form ax2+bx+cax^2 + bx + c.

Conclusion

Introduction

Factoring expressions is a fundamental concept in algebra that involves expressing a polynomial as a product of simpler polynomials. In this article, we will provide a Q&A guide to help you understand the concept of factoring expressions and how to apply it to solve problems.

Q: What is factoring an expression?

A: Factoring an expression involves expressing it as a product of two or more polynomials. This can be done in various ways, including factoring out a common factor, factoring by grouping, or using the quadratic formula.

Q: Why is factoring an expression important?

A: Factoring an expression is important because it can help simplify complex equations and provide insights into the behavior of physical systems. It is also a fundamental concept in algebra that has numerous real-world applications, including physics, engineering, and economics.

Q: How do I factor an expression?

A: To factor an expression, you need to follow these steps:

  1. Look for a common factor.
  2. Use factoring by grouping to simplify complex expressions.
  3. Look for a difference of squares to factor expressions of the form a2b2a^2 - b^2.
  4. Use the quadratic formula to factor expressions of the form ax2+bx+cax^2 + bx + c.

Q: What is a common factor?

A: A common factor is a factor that divides each term of the expression. For example, in the expression 2x+42x + 4, the common factor is 22.

Q: How do I factor out a common factor?

A: To factor out a common factor, you need to divide each term of the expression by the common factor. For example, in the expression 2x+42x + 4, you can factor out the common factor 22 as follows:

2x+4=2(x+2)2x + 4 = 2(x + 2)

Q: What is factoring by grouping?

A: Factoring by grouping involves grouping the terms of the expression into two or more groups and then factoring out a common factor from each group. For example, in the expression x2+5x+6x^2 + 5x + 6, you can group the terms as follows:

x2+5x+6=(x2+3x)+(2x+6)x^2 + 5x + 6 = (x^2 + 3x) + (2x + 6)

Q: How do I factor a difference of squares?

A: To factor a difference of squares, you need to use the formula a2b2=(ab)(a+b)a^2 - b^2 = (a - b)(a + b). For example, in the expression x29x^2 - 9, you can factor it as follows:

x29=(x3)(x+3)x^2 - 9 = (x - 3)(x + 3)

Q: How do I use the quadratic formula to factor an expression?

A: To use the quadratic formula to factor an expression, you need to follow these steps:

  1. Write the expression in the form ax2+bx+cax^2 + bx + c.
  2. Plug the values of aa, bb, and cc into the quadratic formula.
  3. Simplify the expression to get the factored form.

Q: What are some common mistakes to avoid when factoring expressions?

A: Some common mistakes to avoid when factoring expressions include:

  • Not looking for a common factor first.
  • Not using factoring by grouping to simplify complex expressions.
  • Not looking for a difference of squares to factor expressions of the form a2b2a^2 - b^2.
  • Not using the quadratic formula to factor expressions of the form ax2+bx+cax^2 + bx + c.

Conclusion

Factoring expressions is a fundamental concept in algebra that involves expressing a polynomial as a product of simpler polynomials. By following the steps outlined in this Q&A guide, you can learn how to factor expressions and apply it to solve problems. Remember to always look for a common factor first, use factoring by grouping to simplify complex expressions, and look for a difference of squares to factor expressions of the form a2b2a^2 - b^2.