Consider The Unbalanced Reaction: N I S 2 ( S ) + O 2 ( G ) → N I O ( S ) + S O 2 ( G NiS_2(s) + O_2(g) \rightarrow NiO(s) + SO_2(g N I S 2 ​ ( S ) + O 2 ​ ( G ) → N I O ( S ) + S O 2 ​ ( G ]1. The Theoretical Yield Of N I O NiO N I O Is __________ (number And Unit).2. The Limiting Reactant Is __________ (name Or Symbol).3. __________% (Remember To

by ADMIN 353 views

Understanding the Importance of Balancing Chemical Equations

Balancing chemical equations is a crucial step in understanding chemical reactions. It involves making sure that the number of atoms for each element is the same on both the reactant and product sides of the equation. This is essential in determining the theoretical yield of a product and identifying the limiting reactant. In this article, we will explore how to balance the given chemical equation and identify the limiting reactant.

Balancing the Chemical Equation

The given unbalanced chemical equation is:

NiS2(s)+O2(g)NiO(s)+SO2(g)NiS_2(s) + O_2(g) \rightarrow NiO(s) + SO_2(g)

To balance this equation, we need to make sure that the number of atoms for each element is the same on both sides. Let's start by balancing the sulfur (S) atoms. We have 2 sulfur atoms on the reactant side and 1 sulfur atom on the product side. To balance the sulfur atoms, we need to multiply the SO2SO_2 molecule by 2:

NiS2(s)+O2(g)NiO(s)+2SO2(g)NiS_2(s) + O_2(g) \rightarrow NiO(s) + 2SO_2(g)

Next, we need to balance the oxygen (O) atoms. We have 2 oxygen atoms on the reactant side and 1 oxygen atom on the product side, plus 4 oxygen atoms from the 2 SO2SO_2 molecules. To balance the oxygen atoms, we need to multiply the O2O_2 molecule by 2:

NiS2(s)+2O2(g)NiO(s)+2SO2(g)NiS_2(s) + 2O_2(g) \rightarrow NiO(s) + 2SO_2(g)

Now, we need to balance the nickel (Ni) atoms. We have 1 nickel atom on the reactant side and 1 nickel atom on the product side. The nickel atoms are already balanced.

The balanced chemical equation is:

NiS2(s)+2O2(g)NiO(s)+2SO2(g)NiS_2(s) + 2O_2(g) \rightarrow NiO(s) + 2SO_2(g)

Calculating the Theoretical Yield of NiO

To calculate the theoretical yield of NiONiO, we need to know the number of moles of NiONiO produced and the molar mass of NiONiO. The molar mass of NiONiO is 74.69 g/mol.

Let's assume that we have 100 g of NiS2NiS_2. We need to calculate the number of moles of NiS2NiS_2:

moles of NiS2=mass of NiS2molar mass of NiS2moles\ of\ NiS_2 = \frac{mass\ of\ NiS_2}{molar\ mass\ of\ NiS_2}

The molar mass of NiS2NiS_2 is 154.76 g/mol.

moles of NiS2=100 g154.76 g/mol=0.646 molmoles\ of\ NiS_2 = \frac{100\ g}{154.76\ g/mol} = 0.646\ mol

Since the balanced chemical equation shows that 1 mole of NiS2NiS_2 produces 1 mole of NiONiO, we can calculate the number of moles of NiONiO produced:

moles of NiO=moles of NiS2=0.646 molmoles\ of\ NiO = moles\ of\ NiS_2 = 0.646\ mol

Now, we can calculate the mass of NiONiO produced:

mass of NiO=moles of NiO×molar mass of NiOmass\ of\ NiO = moles\ of\ NiO \times molar\ mass\ of\ NiO

mass of NiO=0.646 mol×74.69 g/mol=48.3 gmass\ of\ NiO = 0.646\ mol \times 74.69\ g/mol = 48.3\ g

Therefore, the theoretical yield of NiONiO is 48.3 g.

Identifying the Limiting Reactant

To identify the limiting reactant, we need to compare the mole ratio of the reactants to the mole ratio of the products. Let's assume that we have 100 g of NiS2NiS_2 and 100 g of O2O_2.

We need to calculate the number of moles of NiS2NiS_2 and O2O_2:

moles of NiS2=mass of NiS2molar mass of NiS2moles\ of\ NiS_2 = \frac{mass\ of\ NiS_2}{molar\ mass\ of\ NiS_2}

moles of NiS2=100 g154.76 g/mol=0.646 molmoles\ of\ NiS_2 = \frac{100\ g}{154.76\ g/mol} = 0.646\ mol

moles of O2=mass of O2molar mass of O2moles\ of\ O_2 = \frac{mass\ of\ O_2}{molar\ mass\ of\ O_2}

The molar mass of O2O_2 is 32 g/mol.

moles of O2=100 g32 g/mol=3.125 molmoles\ of\ O_2 = \frac{100\ g}{32\ g/mol} = 3.125\ mol

The balanced chemical equation shows that 1 mole of NiS2NiS_2 requires 2 moles of O2O_2. Therefore, the mole ratio of NiS2NiS_2 to O2O_2 is 1:2.

We can calculate the number of moles of O2O_2 required to react with 0.646 mol of NiS2NiS_2:

moles of O2 required=2×moles of NiS2moles\ of\ O_2\ required = 2 \times moles\ of\ NiS_2

moles of O2 required=2×0.646 mol=1.292 molmoles\ of\ O_2\ required = 2 \times 0.646\ mol = 1.292\ mol

Since we have 3.125 mol of O2O_2, which is more than the required 1.292 mol, O2O_2 is in excess. Therefore, NiS2NiS_2 is the limiting reactant.

Conclusion

In conclusion, we have balanced the given chemical equation and identified the limiting reactant. The balanced chemical equation is:

NiS2(s)+2O2(g)NiO(s)+2SO2(g)NiS_2(s) + 2O_2(g) \rightarrow NiO(s) + 2SO_2(g)

The theoretical yield of NiONiO is 48.3 g. The limiting reactant is NiS2NiS_2.

References

  • Chemistry: An Atoms First Approach, by Steven S. Zumdahl
  • General Chemistry: Principles and Modern Applications, by Linus Pauling

Discussion

What are some common mistakes that people make when balancing chemical equations?

How do you determine the limiting reactant in a chemical reaction?

Q: What is the purpose of balancing chemical equations?

A: The purpose of balancing chemical equations is to ensure that the number of atoms for each element is the same on both the reactant and product sides of the equation. This is essential in determining the theoretical yield of a product and identifying the limiting reactant.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, you need to make sure that the number of atoms for each element is the same on both the reactant and product sides of the equation. You can do this by multiplying the molecules of the reactants and products by the necessary coefficients.

Q: What is the difference between a balanced equation and an unbalanced equation?

A: A balanced equation is an equation in which the number of atoms for each element is the same on both the reactant and product sides of the equation. An unbalanced equation is an equation in which the number of atoms for each element is not the same on both the reactant and product sides of the equation.

Q: How do I determine the limiting reactant in a chemical reaction?

A: To determine the limiting reactant in a chemical reaction, you need to compare the mole ratio of the reactants to the mole ratio of the products. The reactant that is present in the smallest amount is the limiting reactant.

Q: What is the significance of the limiting reactant in a chemical reaction?

A: The limiting reactant in a chemical reaction is the reactant that determines the amount of product that can be formed. It is the reactant that is present in the smallest amount and is therefore the reactant that limits the amount of product that can be formed.

Q: How do I calculate the theoretical yield of a product?

A: To calculate the theoretical yield of a product, you need to know the number of moles of the product that can be formed and the molar mass of the product. You can then use the formula: theoretical yield = number of moles x molar mass.

Q: What are some common mistakes that people make when balancing chemical equations?

A: Some common mistakes that people make when balancing chemical equations include:

  • Not balancing the equation correctly
  • Not using the correct coefficients
  • Not checking the equation for errors

Q: How do I avoid making mistakes when balancing chemical equations?

A: To avoid making mistakes when balancing chemical equations, you need to:

  • Read the equation carefully
  • Use the correct coefficients
  • Check the equation for errors
  • Use a balanced equation chart to help you balance the equation

Q: What are some real-world applications of balancing chemical equations and identifying limiting reactants?

A: Some real-world applications of balancing chemical equations and identifying limiting reactants include:

  • Calculating the amount of product that can be formed in a chemical reaction
  • Determining the amount of reactant that is required to form a certain amount of product
  • Understanding the stoichiometry of a chemical reaction
  • Designing chemical reactions to produce a specific amount of product

Q: How do I use balancing chemical equations and identifying limiting reactants in real-world applications?

A: To use balancing chemical equations and identifying limiting reactants in real-world applications, you need to:

  • Understand the stoichiometry of the chemical reaction
  • Calculate the amount of product that can be formed
  • Determine the amount of reactant that is required to form a certain amount of product
  • Use the balanced equation to design the chemical reaction

Conclusion

In conclusion, balancing chemical equations and identifying limiting reactants are essential skills in chemistry. By understanding how to balance chemical equations and identify limiting reactants, you can calculate the theoretical yield of a product and determine the amount of reactant that is required to form a certain amount of product. These skills are essential in real-world applications, such as designing chemical reactions and calculating the amount of product that can be formed.