Consider The Chemical Equation For The Combustion Of Sugar:${ C_6H_{12}O_6(s) + O_2(g) \rightarrow CO_2(g) + H_2O(l) }$Which Sequence Of Coefficients Should Be Placed In The Blanks To Balance This Equation?A. 1, 6, 6, 6 B. 6, 1, 6, 1 C. 3,

by ADMIN 243 views

Understanding the Importance of Balancing Chemical Equations

Balancing chemical equations is a crucial step in chemistry that helps us understand the stoichiometry of chemical reactions. It ensures that the number of atoms for each element is the same on both the reactant and product sides of the equation. In this article, we will focus on balancing the chemical equation for the combustion of sugar, which is represented by the equation:

C6H12O6(s)+O2(g)CO2(g)+H2O(l){ C_6H_{12}O_6(s) + O_2(g) \rightarrow CO_2(g) + H_2O(l) }

The Rules for Balancing Chemical Equations

Before we dive into balancing the equation, let's review the rules for balancing chemical equations:

  1. Count the atoms: Start by counting the number of atoms for each element on both the reactant and product sides of the equation.
  2. Balance elements in order: Balance elements in the order of their atomic mass, starting with the elements that have the highest atomic mass.
  3. Use coefficients: Use coefficients to balance the elements. Coefficients are numbers placed in front of the formulas of reactants or products to balance the equation.
  4. Check your work: Once you have balanced the equation, check your work by counting the number of atoms for each element on both sides of the equation.

Balancing the Equation for the Combustion of Sugar

Now that we have reviewed the rules for balancing chemical equations, let's apply them to the equation for the combustion of sugar:

C6H12O6(s)+O2(g)CO2(g)+H2O(l){ C_6H_{12}O_6(s) + O_2(g) \rightarrow CO_2(g) + H_2O(l) }

Step 1: Count the Atoms

Let's start by counting the number of atoms for each element on both the reactant and product sides of the equation:

Reactant side:

  • Carbon (C): 6
  • Hydrogen (H): 12
  • Oxygen (O): 6
  • Oxygen (O) from O2: 2

Product side:

  • Carbon (C): 1
  • Hydrogen (H): 2
  • Oxygen (O): 3

Step 2: Balance Elements in Order

Now that we have counted the atoms, let's balance the elements in order of their atomic mass, starting with the elements that have the highest atomic mass:

  1. Carbon (C): We have 6 carbon atoms on the reactant side and 1 carbon atom on the product side. To balance carbon, we need to multiply the formula for CO2 by 6:

C6H12O6(s)+O2(g)6CO2(g)+H2O(l){ C_6H_{12}O_6(s) + O_2(g) \rightarrow 6CO_2(g) + H_2O(l) }

  1. Hydrogen (H): We have 12 hydrogen atoms on the reactant side and 2 hydrogen atoms on the product side. To balance hydrogen, we need to multiply the formula for H2O by 6:

C6H12O6(s)+O2(g)6CO2(g)+6H2O(l){ C_6H_{12}O_6(s) + O_2(g) \rightarrow 6CO_2(g) + 6H_2O(l) }

  1. Oxygen (O): We have 6 oxygen atoms on the reactant side and 18 oxygen atoms on the product side (12 oxygen atoms from 6CO2 and 6 oxygen atoms from 6H2O). To balance oxygen, we need to multiply the formula for O2 by 9:

C6H12O6(s)+9O2(g)6CO2(g)+6H2O(l){ C_6H_{12}O_6(s) + 9O_2(g) \rightarrow 6CO_2(g) + 6H_2O(l) }

Step 3: Check Your Work

Now that we have balanced the equation, let's check our work by counting the number of atoms for each element on both sides of the equation:

Reactant side:

  • Carbon (C): 6
  • Hydrogen (H): 12
  • Oxygen (O): 18

Product side:

  • Carbon (C): 6
  • Hydrogen (H): 12
  • Oxygen (O): 18

The equation is now balanced!

Conclusion

Balancing chemical equations is a crucial step in chemistry that helps us understand the stoichiometry of chemical reactions. By following the rules for balancing chemical equations and applying them to the equation for the combustion of sugar, we have successfully balanced the equation. Remember to count the atoms, balance elements in order, use coefficients, and check your work to ensure that the equation is balanced.

Answer to the Discussion Question

The correct answer to the discussion question is:

A. 1, 6, 6, 6

Q: What is the purpose of balancing chemical equations?

A: The purpose of balancing chemical equations is to ensure that the number of atoms for each element is the same on both the reactant and product sides of the equation. This helps us understand the stoichiometry of chemical reactions and ensures that the equation is correct.

Q: What are the rules for balancing chemical equations?

A: The rules for balancing chemical equations are:

  1. Count the atoms: Start by counting the number of atoms for each element on both the reactant and product sides of the equation.
  2. Balance elements in order: Balance elements in the order of their atomic mass, starting with the elements that have the highest atomic mass.
  3. Use coefficients: Use coefficients to balance the elements. Coefficients are numbers placed in front of the formulas of reactants or products to balance the equation.
  4. Check your work: Once you have balanced the equation, check your work by counting the number of atoms for each element on both sides of the equation.

Q: How do I balance a chemical equation?

A: To balance a chemical equation, follow these steps:

  1. Count the atoms: Start by counting the number of atoms for each element on both the reactant and product sides of the equation.
  2. Balance elements in order: Balance elements in the order of their atomic mass, starting with the elements that have the highest atomic mass.
  3. Use coefficients: Use coefficients to balance the elements. Coefficients are numbers placed in front of the formulas of reactants or products to balance the equation.
  4. Check your work: Once you have balanced the equation, check your work by counting the number of atoms for each element on both sides of the equation.

Q: What is the difference between a balanced and unbalanced chemical equation?

A: A balanced chemical equation has the same number of atoms for each element on both the reactant and product sides of the equation. An unbalanced chemical equation does not have the same number of atoms for each element on both sides of the equation.

Q: Why is it important to balance chemical equations?

A: It is important to balance chemical equations because it helps us understand the stoichiometry of chemical reactions. Balancing chemical equations ensures that the equation is correct and that the number of atoms for each element is the same on both sides of the equation.

Q: Can I balance a chemical equation by trial and error?

A: While it is possible to balance a chemical equation by trial and error, it is not the most efficient way to do so. By following the rules for balancing chemical equations, you can ensure that the equation is balanced and that the number of atoms for each element is the same on both sides of the equation.

Q: How do I know if a chemical equation is balanced?

A: To determine if a chemical equation is balanced, count the number of atoms for each element on both the reactant and product sides of the equation. If the number of atoms for each element is the same on both sides of the equation, then the equation is balanced.

Q: What are some common mistakes to avoid when balancing chemical equations?

A: Some common mistakes to avoid when balancing chemical equations include:

  • Not counting the atoms: Make sure to count the atoms for each element on both the reactant and product sides of the equation.
  • Not balancing elements in order: Balance elements in the order of their atomic mass, starting with the elements that have the highest atomic mass.
  • Not using coefficients: Use coefficients to balance the elements. Coefficients are numbers placed in front of the formulas of reactants or products to balance the equation.
  • Not checking your work: Once you have balanced the equation, check your work by counting the number of atoms for each element on both sides of the equation.

Conclusion

Balancing chemical equations is a crucial step in chemistry that helps us understand the stoichiometry of chemical reactions. By following the rules for balancing chemical equations and avoiding common mistakes, you can ensure that the equation is balanced and that the number of atoms for each element is the same on both sides of the equation.