Balance The Following Chemical Equation: F E 2 O 3 + H 2 S O 4 → F E 2 ( S O 4 ) 3 + H 2 O Fe_2O_3 + H_2SO_4 \rightarrow Fe_2(SO_4)_3 + H_2O F E 2 ​ O 3 ​ + H 2 ​ S O 4 ​ → F E 2 ​ ( S O 4 ​ ) 3 ​ + H 2 ​ O

by ADMIN 207 views

Balancing chemical equations is a crucial aspect of chemistry that helps us understand the stoichiometry of chemical reactions. In this article, we will focus on balancing the chemical equation: Fe2O3+H2SO4Fe2(SO4)3+H2OFe_2O_3 + H_2SO_4 \rightarrow Fe_2(SO_4)_3 + H_2O. This equation represents the reaction between iron(III) oxide and sulfuric acid to produce iron(II) sulfate and water.

Understanding the Chemical Equation

Before we dive into balancing the equation, let's understand the chemical reaction it represents. The reaction involves the reaction of iron(III) oxide (Fe2O3Fe_2O_3) with sulfuric acid (H2SO4H_2SO_4) to produce iron(II) sulfate (Fe2(SO4)3Fe_2(SO_4)_3) and water (H2OH_2O). This reaction is a common example of a redox reaction, where iron is oxidized from its +3 oxidation state to its +2 oxidation state.

Step 1: Write the Unbalanced Equation

The first step in balancing a chemical equation is to write the unbalanced equation. In this case, the unbalanced equation is:

Fe2O3+H2SO4Fe2(SO4)3+H2OFe_2O_3 + H_2SO_4 \rightarrow Fe_2(SO_4)_3 + H_2O

Step 2: Count the Atoms

The next step is to count the number of atoms of each element on both the reactant and product sides of the equation. This will help us identify which elements are imbalanced.

Element Reactant Side Product Side
Fe 2 2
O 3 9
H 2 2
S 1 3

Step 3: Balance the Elements

Now that we have counted the atoms, we can start balancing the elements. We will start with the elements that appear only once on each side of the equation, which are iron (Fe) and hydrogen (H). Since there are 2 atoms of Fe on both sides, we can leave it as it is. However, we need to balance the H atoms. Since there are 2 H atoms on both sides, we can leave it as it is.

Next, we will balance the S atoms. Since there is 1 S atom on the reactant side and 3 S atoms on the product side, we need to multiply the H2SO4 molecule by 3 to get 3 S atoms on the reactant side.

Fe2O3+3H2SO4Fe2(SO4)3+H2OFe_2O_3 + 3H_2SO_4 \rightarrow Fe_2(SO_4)_3 + H_2O

Step 4: Balance the O Atoms

Now that we have balanced the S atoms, we need to balance the O atoms. Since there are 3 O atoms on the reactant side and 9 O atoms on the product side, we need to multiply the Fe2O3 molecule by 3 to get 9 O atoms on the reactant side.

2Fe2O3+3H2SO4Fe2(SO4)3+3H2O2Fe_2O_3 + 3H_2SO_4 \rightarrow Fe_2(SO_4)_3 + 3H_2O

Step 5: Check the Balance

Now that we have balanced the elements, we need to check if the equation is balanced. We can do this by counting the atoms of each element on both sides of the equation.

Element Reactant Side Product Side
Fe 4 2
O 9 9
H 6 6
S 3 3

The equation is now balanced.

Conclusion

Balancing chemical equations is a crucial aspect of chemistry that helps us understand the stoichiometry of chemical reactions. In this article, we have balanced the chemical equation: Fe2O3+H2SO4Fe2(SO4)3+H2OFe_2O_3 + H_2SO_4 \rightarrow Fe_2(SO_4)_3 + H_2O. We have followed the steps of writing the unbalanced equation, counting the atoms, balancing the elements, and checking the balance. The balanced equation is:

2Fe2O3+3H2SO4Fe2(SO4)3+3H2O2Fe_2O_3 + 3H_2SO_4 \rightarrow Fe_2(SO_4)_3 + 3H_2O

In our previous article, we discussed the steps involved in balancing chemical equations, using the example of the reaction between iron(III) oxide and sulfuric acid to produce iron(II) sulfate and water. In this article, we will answer some frequently asked questions about balancing chemical equations.

Q: What is the purpose of balancing chemical equations?

A: The purpose of balancing chemical equations is to ensure that the number of atoms of each element is the same on both the reactant and product sides of the equation. This is important because it helps us understand the stoichiometry of chemical reactions, which is the quantitative relationship between the reactants and products.

Q: How do I know if a chemical equation is balanced?

A: To determine if a chemical equation is balanced, you need to count the number of atoms of each element on both the reactant and product sides of the equation. If the number of atoms of each element is the same on both sides, then the equation is balanced.

Q: What are the steps involved in balancing a chemical equation?

A: The steps involved in balancing a chemical equation are:

  1. Write the unbalanced equation
  2. Count the number of atoms of each element on both the reactant and product sides of the equation
  3. Balance the elements, starting with the elements that appear only once on each side of the equation
  4. Check the balance to ensure that the number of atoms of each element is the same on both sides of the equation

Q: How do I balance a chemical equation with multiple reactants or products?

A: To balance a chemical equation with multiple reactants or products, you need to follow the same steps as before. However, you may need to use coefficients to balance the equation. Coefficients are numbers that are placed in front of the formulas of the reactants or products to indicate the number of molecules of each substance that are involved in the reaction.

Q: What is the difference between a balanced and an unbalanced chemical equation?

A: A balanced chemical equation has the same number of atoms of each element on both the reactant and product sides of the equation. An unbalanced chemical equation has a different number of atoms of each element on the reactant and product sides.

Q: Can a chemical equation be balanced in more than one way?

A: Yes, a chemical equation can be balanced in more than one way. However, only one of these ways is correct. The correct way is the one that has the same number of atoms of each element on both the reactant and product sides of the equation.

Q: How do I know which way to balance a chemical equation?

A: To determine which way to balance a chemical equation, you need to follow the steps involved in balancing a chemical equation. You also need to use your knowledge of chemistry to determine which elements are imbalanced and how to balance them.

Q: What are some common mistakes to avoid when balancing chemical equations?

A: Some common mistakes to avoid when balancing chemical equations include:

  • Not counting the number of atoms of each element on both the reactant and product sides of the equation
  • Not using coefficients to balance the equation
  • Not checking the balance to ensure that the number of atoms of each element is the same on both sides of the equation
  • Not using the correct method to balance the equation

Conclusion

Balancing chemical equations is an important aspect of chemistry that helps us understand the stoichiometry of chemical reactions. By following the steps involved in balancing a chemical equation and using your knowledge of chemistry, you can ensure that the equation is balanced and accurate.